Item 1 of 33 (back to results) next deamido-NAD zwitterion null

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > carbon group molecular entity [CHEBI:33582] > organic molecular entity [CHEBI:50860] > heteroorganic entity [CHEBI:33285] > organophosphorus compound [CHEBI:25710] > organic phosphate [CHEBI:25703] > nucleoside phosphate [CHEBI:25608] > nucleotide [CHEBI:36976] > dinucleotide [CHEBI:47885] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   phosphorus molecular entity [CHEBI:26082] (2769)   organophosphorus compound [CHEBI:25710] (1528)   organic phosphate [CHEBI:25703] (1511)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  phosphorus oxoacids and derivatives [CHEBI:36360] (2691)   phosphorus oxoacid derivative [CHEBI:36359] (2628)   phosphoric acid derivative [CHEBI:26079] (2611)   organic phosphate [CHEBI:25703] (1511)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  phosphate [CHEBI:26020] (1522)   organic phosphate [CHEBI:25703] (1511)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  phosphoric ester [CHEBI:37734] (1466)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organophosphorus compound [CHEBI:25710] (1528)   organic phosphate [CHEBI:25703] (1511)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  ester [CHEBI:35701] (3370)   phosphoric ester [CHEBI:37734] (1466)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   nucleobase-containing molecular entity [CHEBI:61120] (573)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   phosphorus oxoacid derivative [CHEBI:36359] (2628)   phosphoric acid derivative [CHEBI:26079] (2611)   organic phosphate [CHEBI:25703] (1511)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  phosphate [CHEBI:26020] (1522)   organic phosphate [CHEBI:25703] (1511)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  phosphoric ester [CHEBI:37734] (1466)   nucleoside phosphate [CHEBI:25608] (412)   nucleotide [CHEBI:36976] (398)   pyridine nucleotide [CHEBI:36980] (16)   nicotinic acid nucleotide [CHEBI:25534] (3)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1)  dinucleotide [CHEBI:47885] (33)   nicotinic acid dinucleotide [CHEBI:37584] (2)   deamido-NAD zwitterion [CHEBI:14105] (1) ChEBI Compound Accession Identifier:   [CHEBI:14105] ChEBI Compound Description:   null ChEBI Compound Identification Number:   14105 ChEBI InChI Value:   InChI=1S/C21H26N6O15P2/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(31)14(29)11(41-20)6-39-44(36,37)42-43(34,35)38-5-10-13(28)15(30)19(40-10)26-3-1-2-9(4-26)21(32)33/h1-4,7-8,10-11,13-16,19-20,28-31H,5-6H2,(H4-,22,23,24,32,33,34,35,36,37)/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 ChEBI InChIKey Value:   SENPVEZBRZQVST-HISDBWNOSA-N ChEBI Compound Name:   deamido-NAD zwitterion ChEBI SMILES Value:   Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)[n+]2cccc(c2)C(O)=O)[C@@H](O)[C@H]1O ChEBI Substance ID:   26744230 ChEBI URL:   ChEBI:14105 ChemSpider ID:   145042 Ontomatica Chemical Accession Key (OnChAKey):   SENPVEZBRZQVST_HISDBWNOSA_N_000_000000 PubChem Compound ID:   16755622