New Search

Item 1 of 18 (back to results)
next Next

4a,5-dihydroriboflavin
Riboflavin in which the double bond between positions 4a and 5 has been reduced to a single bond.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzopteridine [CHEBI:38925] (18) 
 flavin [CHEBI:30527] (12) 
 dihydroriboflavins [CHEBI:15031] (2) 
 4a,5-dihydroriboflavin [CHEBI:8798] (1)
ChEBI Compound Accession Identifier  [CHEBI:8798]
ChEBI Compound Description  Riboflavin in which the double bond between positions 4a and 5 has been reduced to a single bond.
ChEBI Compound Identification Number  8798
ChEBI InChI Value  InChI=1S/C17H22N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-14,18,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,13?,14-/m0/s1
ChEBI InChIKey Value  UTKDOUCGQVLJIN-PIGZVRMJSA-N
ChEBI Compound Name  4a,5-dihydroriboflavin
ChEBI SMILES Value  Cc1cc2NC3C(=O)NC(=O)N=C3N(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C
ChEBI Substance ID  49658634
ChEBI URL  ChEBI:8798
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  UTKDOUCGQVLJIN_PIGZVRMJSA_N_000_000000
PubChem Compound ID  45480537