| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Milk, fat (24) | 
 | 
| 
 | 
 Poultry, fat (34) | 
 | 
| 
 | 
 Poultry, liver (8) | 
 | 
| 
 | 
 Poultry, meat (32) | 
 | 
| 
 | 
 Poultry, meat byproducts (except liver) (4) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Globe Artichoke (19) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 Radish, leaves (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 Kohlrabi (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 Collards (8) | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Snap bean (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Pepper (15) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Muskmelon (3) | 
 | 
| 
 | 
 Watermelon (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Pumpkin (8) | 
 | 
| 
 | 
 Squash, winter (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13 Subgroup 13A : Caneberry (blackberry & raspberry) subgroup (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blueberry, highbush & lowbush (15) | 
 | 
| 
 | 
 Elderberry (2) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Elderberry (2) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Elderberry (2) | 
 | 
| 
 | 
 Elderberry (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sunflower, seed (16) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 esfenvalerate [CHEBI:39346] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:39346] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 39346 | 
| ChEBI InChI Value:  | 
 InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/t23-,24+/m1/s1 | 
| ChEBI InChIKey Value:  | 
 NYPJDWWKZLNGGM-RPWUZVMVSA-N | 
| ChEBI Compound Name:  | 
 esfenvalerate | 
| ChEBI SMILES Value:  | 
 CC(C)[C@H](C(=O)O[C@H](C#N)c1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1 | 
| ChEBI Substance ID:  | 
 26675852 | 
| ChEBI URL:  | 
 ChEBI:39346 | 
| ChemSpider ID:  | 
 8517510 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 NYPJDWWKZLNGGM_RPWUZVMVSA_N_000_000000 | 
| PubChem Compound ID:  | 
 10342051 |