New Search

Item 1 of 1 (back to results)

gaudichaudiic acid F
An organic heteroheptacyclic compound isolated from the bark of Indonesian Garcinia gaudichaudii and exhibits cytotoxic activity.


Current search:

06. Name of Biological Source of Chemical: Plantae
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > gaudichaudiic acid F [CHEBI:65950]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 gaudichaudiic acid F [CHEBI:65950] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 gaudichaudiic acid F [CHEBI:65950] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Malpighiales (287) 
 Family Clusiaceae (67) 
 Subfamily Clusioideae (33) 
 Tribe Garcinieae (32) 
 Garcinia (32) 
 Garcinia gaudichaudii (4)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 portion of plant tissue [PO:0009007] (272) 
 bark [PO:0004518] (82)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 bridged compound [CHEBI:35990] (118) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteroheptacyclic compound [CHEBI:52157] (22) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 gaudichaudiic acid F [CHEBI:65950] (1)
ChEBI Compound Accession Identifier  [CHEBI:65950]
ChEBI Compound Description  An organic heteroheptacyclic compound isolated from the bark of Indonesian Garcinia gaudichaudii and exhibits cytotoxic activity.
ChEBI Compound Identification Number  65950
ChEBI InChI Value  InChI=1S/C40H50O9/c1-11-36(5,6)28-32-25(21-17-19(3)13-14-23(21)37(7,8)47-32)29(41)26-30(42)27-31(46-12-2)22-18-24-38(9,10)49-39(34(22)43,16-15-20(4)35(44)45)40(24,27)48-33(26)28/h11,15,17,21-24,27,31,41H,1,12-14,16,18H2,2-10H3,(H,44,45)/b20-15+/t21?,22-,23?,24-,27?,31?,39-,40-/m1/s1
ChEBI InChIKey Value  DDXYKUAYCPOGSR-BJBPENEPSA-N
ChEBI Compound Name  gaudichaudiic acid F
ChEBI SMILES Value  [H][C@]12C[C@]3([H])C(C)(C)O[C@](C\C=C(/C)C(O)=O)(C1=O)[C@@]31Oc3c(C(=O)C1C2OCC)c(O)c1C2C=C(C)CCC2C(C)(C)Oc1c3C(C)(C)C=C
ChEBI Substance ID  160709630
ChEBI URL  ChEBI:65950
ChemSpider ID  8875029
Ontomatica Chemical Accession Key (OnChAKey)  DDXYKUAYCPOGSR_BJBPENEPSA_N_000_000000
PubChem Compound ID  10699688