New Search

Item 1 of 1 (back to results)

stevastelin B
A 15-membered cyclodepsipeptide isolated from the culture broth of Penicillium sp. It exhibits significant immunosuppressive effect on T-cell activiation.


Current search:

07. Part of Biological Source of Chemical: unspecified structure [PO:0000004]
×
03. Biological Effects of Specific Chemicals: immunomodulator [CHEBI:50846] > immunosuppressive agent [CHEBI:35705] > stevastelin B [CHEBI:66522]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 stevastelin B [CHEBI:66522] (1)
 immunomodulator [CHEBI:50846] (61) 
 immunosuppressive agent [CHEBI:35705] (43) 
 stevastelin B [CHEBI:66522] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Fungi, Yeasts, Molds and Mildews (348) 
 Deuteromycotina (255) 
 Ochroconis (97) 
 Penicillium (97)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 ester [CHEBI:35701] (3370) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 depsipeptide [CHEBI:23643] (64) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 macrocycle [CHEBI:51026] (234) 
 stevastelin B [CHEBI:66522] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 cyclodepsipeptide [CHEBI:35213] (63) 
 stevastelin B [CHEBI:66522] (1)
ChEBI Compound Accession Identifier  [CHEBI:66522]
ChEBI Compound Description  A 15-membered cyclodepsipeptide isolated from the culture broth of Penicillium sp. It exhibits significant immunosuppressive effect on T-cell activiation.
ChEBI Compound Identification Number  66522
ChEBI InChI Value  InChI=1S/C34H61N3O9/c1-8-9-10-11-12-13-14-15-16-17-18-19-27-22(4)30(40)23(5)31(41)36-28(21(2)3)32(42)37-29(24(6)38)33(43)35-26(34(44)46-27)20-45-25(7)39/h21-24,26-30,38,40H,8-20H2,1-7H3,(H,35,43)(H,36,41)(H,37,42)/t22-,23+,24+,26-,27+,28-,29-,30+/m0/s1
ChEBI InChIKey Value  UTYDHKYGSNIIDV-RFYOCORYSA-N
ChEBI Compound Name  stevastelin B
ChEBI SMILES Value  CCCCCCCCCCCCC[C@H]1OC(=O)[C@H](COC(C)=O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)[C@H](O)[C@H]1C)C(C)C)[C@@H](C)O
ChEBI Substance ID  160645246
ChEBI URL  ChEBI:66522
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  UTYDHKYGSNIIDV_RFYOCORYSA_N_000_000000
PubChem Compound ID  10508510