New Search

Item 1 of 8 (back to results)
next Next

brinzolamide
null


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > ophthalmology drug [CHEBI:66981]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 carbonic anhydrase inhibitor [CHEBI:23018] (9) 
 brinzolamide [CHEBI:3176] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 ophthalmology drug [CHEBI:66981] (30) 
 antiglaucoma drug [CHEBI:39456] (28) 
 brinzolamide [CHEBI:3176] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 sulfonamide [CHEBI:35358] (106) 
 brinzolamide [CHEBI:3176] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 brinzolamide [CHEBI:3176] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thienothiazine [CHEBI:46977] (1) 
 brinzolamide [CHEBI:3176] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 brinzolamide [CHEBI:3176] (1)
ChEBI Compound Accession Identifier  [CHEBI:3176]
ChEBI Compound Description  null
ChEBI Compound Identification Number  3176
ChEBI InChI Value  InChI=1S/C12H21N3O5S3/c1-3-14-10-8-15(5-4-6-20-2)23(18,19)12-9(10)7-11(21-12)22(13,16)17/h7,10,14H,3-6,8H2,1-2H3,(H2,13,16,17)/t10-/m0/s1
ChEBI InChIKey Value  HCRKCZRJWPKOAR-JTQLQIEISA-N
ChEBI Compound Name  brinzolamide
ChEBI SMILES Value  CCN[C@H]1CN(CCCOC)S(=O)(=O)c2sc(cc12)S(N)(=O)=O
ChEBI Substance ID  29214990
ChEBI URL  ChEBI:3176
ChemSpider ID  62077
Ontomatica Chemical Accession Key (OnChAKey)  HCRKCZRJWPKOAR_JTQLQIEISA_N_000_000000
PubChem Compound ID  68844