New Search

Item 1 of 1 (back to results)

graminone B
A lignan that is tetrahydro-1H,3H-furo[3,4-c]furan-1-one substituted by a 3-hydroxy-4,5-dimethoxyphenyl at position 3 and a 3-hydroxy-4,5-dimethoxyphenyl group at position 5. Isolated from the rhizomes of Imperata cylindrica, it exhibits vasodilative activity.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > graminone B [CHEBI:65979]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > cardiovascular drug [CHEBI:35554]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 graminone B [CHEBI:65979] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 cardiovascular drug [CHEBI:35554] (162) 
 vasodilator agent [CHEBI:35620] (65) 
 graminone B [CHEBI:65979] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Liliopsida (183) 
 Poales (46) 
 Poaceae (42) 
 Imperata (2) 
 Imperata cylindrica (2)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 plant axis [PO:0025004] (691) 
 shoot axis [PO:0025029] (271) 
 rhizome [PO:0004542] (88)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 ester [CHEBI:35701] (3370) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 graminone B [CHEBI:65979] (1)
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 graminone B [CHEBI:65979] (1)
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 graminone B [CHEBI:65979] (1)
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 graminone B [CHEBI:65979] (1)
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 graminone B [CHEBI:65979] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 lactone [CHEBI:25000] (516) 
 gamma-lactone [CHEBI:37581] (157) 
 graminone B [CHEBI:65979] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 graminone B [CHEBI:65979] (1)
ChEBI Compound Accession Identifier  [CHEBI:65979]
ChEBI Compound Description  A lignan that is tetrahydro-1H,3H-furo[3,4-c]furan-1-one substituted by a 3-hydroxy-4,5-dimethoxyphenyl at position 3 and a 3-hydroxy-4,5-dimethoxyphenyl group at position 5. Isolated from the rhizomes of Imperata cylindrica, it exhibits vasodilative activity.
ChEBI Compound Identification Number  65979
ChEBI InChI Value  InChI=1S/C21H22O8/c1-25-13-5-10(4-12(22)8-13)19-17-14(9-28-19)18(29-21(17)24)11-6-15(23)20(27-3)16(7-11)26-2/h4-8,14,17-19,22-23H,9H2,1-3H3/t14-,17-,18+,19+/m1/s1
ChEBI InChIKey Value  JTDVCRMQMDJLOR-OAOYMFHYSA-N
ChEBI Compound Name  graminone B
ChEBI SMILES Value  [H][C@@]12CO[C@@H](c3cc(O)cc(OC)c3)[C@]1([H])C(=O)O[C@H]2c1cc(O)c(OC)c(OC)c1
ChEBI Substance ID  160709646
ChEBI URL  ChEBI:65979
ChemSpider ID  8176731
Ontomatica Chemical Accession Key (OnChAKey)  JTDVCRMQMDJLOR_OAOYMFHYSA_N_000_000000
PubChem Compound ID  10001150