New Search

Item 1 of 8 (back to results)
next Next

cerivastatin
(3R,5S)-3,5-dihydroxyhept-6-enoic acid in which the (7E)-hydrogen is substituted by a 4-(4-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)pyridin-3-yl group. Formerly used (as its sodium salt) to lower cholesterol and prevent cardiovascular disease, it was withdrawn from the market worldwide in 2001 following reports of a severe form of muscle toxicity.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > hydroxymethylglutaryl-CoA reductase inhibitor [CHEBI:35664]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 hydroxymethylglutaryl-CoA reductase inhibitor [CHEBI:35664] (10) 
 cerivastatin [CHEBI:3558] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antilipemic drug [CHEBI:35679] (30) 
 cerivastatin [CHEBI:3558] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 cerivastatin [CHEBI:3558] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 monocarboxylic acid [CHEBI:25384] (1620) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 hydroxy carboxylic acid [CHEBI:24669] (422) 
 hydroxy monocarboxylic acid [CHEBI:35868] (396) 
 dihydroxy monocarboxylic acid [CHEBI:35972] (45) 
 cerivastatin [CHEBI:3558] (1)
ChEBI Compound Accession Identifier  [CHEBI:3558]
ChEBI Compound Description  (3R,5S)-3,5-dihydroxyhept-6-enoic acid in which the (7E)-hydrogen is substituted by a 4-(4-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)pyridin-3-yl group. Formerly used (as its sodium salt) to lower cholesterol and prevent cardiovascular disease, it was withdrawn from the market worldwide in 2001 following reports of a severe form of muscle toxicity.
ChEBI Compound Identification Number  3558
ChEBI InChI Value  InChI=1S/C26H34FNO5/c1-15(2)25-21(11-10-19(29)12-20(30)13-23(31)32)24(17-6-8-18(27)9-7-17)22(14-33-5)26(28-25)16(3)4/h6-11,15-16,19-20,29-30H,12-14H2,1-5H3,(H,31,32)/b11-10+/t19-,20-/m1/s1
ChEBI InChIKey Value  SEERZIQQUAZTOL-ANMDKAQQSA-N
ChEBI Compound Name  cerivastatin
ChEBI SMILES Value  COCc1c(nc(C(C)C)c(\C=C\[C@@H](O)C[C@@H](O)CC(O)=O)c1-c1ccc(F)cc1)C(C)C
ChEBI Substance ID  93578306
ChEBI URL  ChEBI:3558
ChemSpider ID  393588
Ontomatica Chemical Accession Key (OnChAKey)  SEERZIQQUAZTOL_ANMDKAQQSA_N_000_000000
PubChem Compound ID  446156