New Search

Item 1 of 1 (back to results)

hydroxyzine
null


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 histaminergic drug [CHEBI:37957] (94) 
 histamine antagonist [CHEBI:37956] (87) 
 H1-receptor antagonist [CHEBI:37955] (57) 
 hydroxyzine [CHEBI:5818] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 anxiolytic drug [CHEBI:35474] (31) 
 hydroxyzine [CHEBI:5818] (1)
 dermatologic drug [CHEBI:50177] (49) 
 hydroxyzine [CHEBI:5818] (1)
 antipruritic drug [CHEBI:59683] (18) 
 hydroxyzine [CHEBI:5818] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 hydroxyzine [CHEBI:5818] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 hydroxyzine [CHEBI:5818] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 hydroxyzine [CHEBI:5818] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 hydroxyzine [CHEBI:5818] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 hydroxyzine [CHEBI:5818] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 hydroxyzine [CHEBI:5818] (1)
ChEBI Compound Accession Identifier  [CHEBI:5818]
ChEBI Compound Description  null
ChEBI Compound Identification Number  5818
ChEBI InChI Value  InChI=1S/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2
ChEBI InChIKey Value  ZQDWXGKKHFNSQK-UHFFFAOYSA-N
ChEBI Compound Name  hydroxyzine
ChEBI SMILES Value  OCCOCCN1CCN(CC1)C(c1ccccc1)c1ccc(Cl)cc1
ChEBI Substance ID  50139270
ChEBI URL  ChEBI:5818
ChemSpider ID  3531
Ontomatica Chemical Accession Key (OnChAKey)  ZQDWXGKKHFNSQK_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3658