New Search

Item 1 of 2 (back to results)
next Next

propiomazine
null


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > serotonergic drug [CHEBI:48278] > serotonergic antagonist [CHEBI:48279]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 histaminergic drug [CHEBI:37957] (94) 
 histamine antagonist [CHEBI:37956] (87) 
 propiomazine [CHEBI:8491] (1)
 cholinergic drug [CHEBI:38323] (108) 
 cholinergic antagonist [CHEBI:48873] (84) 
 muscarinic antagonist [CHEBI:48876] (61) 
 propiomazine [CHEBI:8491] (1)
 serotonergic drug [CHEBI:48278] (109) 
 serotonergic antagonist [CHEBI:48279] (52) 
 propiomazine [CHEBI:8491] (1)
 dopaminergic agent [CHEBI:48560] (99) 
 dopaminergic antagonist [CHEBI:48561] (48) 
 propiomazine [CHEBI:8491] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 antipsychotic agent [CHEBI:35476] (51) 
 first generation antipsychotic [CHEBI:65190] (30) 
 phenothiazine antipsychotic drug [CHEBI:37930] (18) 
 propiomazine [CHEBI:8491] (1)
 central nervous system depressant [CHEBI:35488] (90) 
 sedative [CHEBI:35717] (43) 
 propiomazine [CHEBI:8491] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 secondary amine [CHEBI:32863] (27) 
 propiomazine [CHEBI:8491] (1)
 secondary amino compound [CHEBI:50995] (110) 
 secondary amine [CHEBI:32863] (27) 
 propiomazine [CHEBI:8491] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 propiomazine [CHEBI:8491] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 propiomazine [CHEBI:8491] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 secondary amine [CHEBI:32863] (27) 
 propiomazine [CHEBI:8491] (1)
 secondary amino compound [CHEBI:50995] (110) 
 secondary amine [CHEBI:32863] (27) 
 propiomazine [CHEBI:8491] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 propiomazine [CHEBI:8491] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 secondary amine [CHEBI:32863] (27) 
 propiomazine [CHEBI:8491] (1)
 secondary amino compound [CHEBI:50995] (110) 
 secondary amine [CHEBI:32863] (27) 
 propiomazine [CHEBI:8491] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 propiomazine [CHEBI:8491] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 phenothiazines [CHEBI:38093] (35) 
 propiomazine [CHEBI:8491] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 propiomazine [CHEBI:8491] (1)
ChEBI Compound Accession Identifier  [CHEBI:8491]
ChEBI Compound Description  null
ChEBI Compound Identification Number  8491
ChEBI InChI Value  InChI=1S/C20H24N2OS/c1-5-18(23)15-10-11-20-17(12-15)22(13-14(2)21(3)4)16-8-6-7-9-19(16)24-20/h6-12,14H,5,13H2,1-4H3
ChEBI InChIKey Value  UVOIBTBFPOZKGP-UHFFFAOYSA-N
ChEBI Compound Name  propiomazine
ChEBI SMILES Value  CCC(=O)c1ccc2Sc3ccccc3N(CC(C)N(C)C)c2c1
ChEBI Substance ID  56352892
ChEBI URL  ChEBI:8491
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  UVOIBTBFPOZKGP_UHFFFAOYSA_N_000_000000
PubChem Compound ID  4940