New Search

Item 1 of 1 (back to results)

L-tryptophan
The L-enantiomer of tryptophan.


Current search:

03. Biological Effects of Specific Chemicals: physiological uses [CHEBI:52211] > nutrient [CHEBI:33284] > micronutrient [CHEBI:27027] > L-tryptophan [CHEBI:16828]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > nutraceutical [CHEBI:50733]
×

Select any link to see items in a related category.

more general categories    information about this item
01. Food Nutrient & Dietary Chemicals 
01. Food Nutrient & Dietary Chemicals
 Nitrogen components (43) 
 Amino acids [ChEBI:33709] (23) 
 tryptophan [ChEBI:16828] (1)
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 physiological uses [CHEBI:52211] (63) 
 nutrient [CHEBI:33284] (49) 
 micronutrient [CHEBI:27027] (41) 
 L-tryptophan [CHEBI:16828] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 antidepressant [CHEBI:35469] (44) 
 L-tryptophan [CHEBI:16828] (1)
 nutraceutical [CHEBI:50733] (39) 
 L-tryptophan [CHEBI:16828] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 aminoalkylindole [CHEBI:38631] (5) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 L-alpha-amino acid [CHEBI:15705] (77) 
 L-tryptophan [CHEBI:16828] (1)
 erythrose 4-phosphate/phosphoenolpyruvate family amino acid [CHEBI:73690] (3) 
 L-tryptophan [CHEBI:16828] (1)
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
 aromatic amino acid [CHEBI:33856] (27) 
 tryptophan [CHEBI:27897] (3) 
 L-tryptophan [CHEBI:16828] (1)
ChEBI Compound Accession Identifier  [CHEBI:16828]
ChEBI Compound Description  The L-enantiomer of tryptophan.
ChEBI Compound Identification Number  16828
ChEBI InChI Value  InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
ChEBI InChIKey Value  QIVBCDIJIAJPQS-VIFPVBQESA-N
ChEBI Compound Name  L-tryptophan
ChEBI SMILES Value  N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O
ChEBI Substance ID  8144649
ChEBI URL  ChEBI:16828
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  QIVBCDIJIAJPQS_VIFPVBQESA_N_000_000000
PubChem Compound ID  6305