New Search

Item 1 of 2 (back to results)
next Next

acibenzolar-S-methyl
A benzothiadiazole that is the S-methyl thioester derivative of acibenzolar. It is used as a fungicide and plant activator on a variety of crops, including cotton, chili peppers, lettuce, onions, spinach, tobacco, and tomatoes.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×
05. Industrial Uses: agrochemical [CHEBI:33286] > plant activator [CHEBI:73182]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 fungicide [CHEBI:24127] (52) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
05. Industrial Uses 
05. Industrial Uses
 agrochemical [CHEBI:33286] (142) 
 plant activator [CHEBI:73182] (3) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 thioester [CHEBI:51277] (307) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 thioester [CHEBI:51277] (307) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 thioester [CHEBI:51277] (307) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 ester [CHEBI:35701] (3370) 
 thiocarboxylic ester [CHEBI:26959] (311) 
 thioester [CHEBI:51277] (307) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 thioester [CHEBI:51277] (307) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzothiadiazole [CHEBI:48864] (4) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 thioester [CHEBI:51277] (307) 
 acibenzolar-S-methyl [CHEBI:73178] (1)
ChEBI Compound Accession Identifier  [CHEBI:73178]
ChEBI Compound Description  A benzothiadiazole that is the S-methyl thioester derivative of acibenzolar. It is used as a fungicide and plant activator on a variety of crops, including cotton, chili peppers, lettuce, onions, spinach, tobacco, and tomatoes.
ChEBI Compound Identification Number  73178
ChEBI InChI Value  InChI=1S/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3
ChEBI InChIKey Value  UELITFHSCLAHKR-UHFFFAOYSA-N
ChEBI Compound Name  acibenzolar-S-methyl
ChEBI SMILES Value  CSC(=O)c1cccc2nnsc12
ChEBI Substance ID  162169338
ChEBI URL  ChEBI:73178
ChemSpider ID  77928
Ontomatica Chemical Accession Key (OnChAKey)  UELITFHSCLAHKR_UHFFFAOYSA_N_000_000000
PubChem Compound ID  86412