New Search

Item 1 of 1 (back to results)

lucialdehyde B
A tetracyclic triterpenoid that is lanosta-8,24-dien-26-al substituted by oxo groups at positions 3 and 7. Isolated from Ganoderma lucidum and Ganoderma pfeifferi, it exhibits antiviral and cytotoxic activities.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antineoplastic agent [CHEBI:35610] > lucialdehyde B [CHEBI:66593]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 lucialdehyde B [CHEBI:66593] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antiviral agent [CHEBI:22587] (216) 
 anti-HSV agent [CHEBI:64952] (15) 
 lucialdehyde B [CHEBI:66593] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 lucialdehyde B [CHEBI:66593] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Fungi, Yeasts, Molds and Mildews (348) 
 Dikarya (97) 
 Basidiomycota (16) 
 Agaricomycotina (16) 
 Agaricomycetes (16) 
 Phallomycetidae (11) 
 Ganodermataceae (8) 
 Ganoderma (8) 
 Ganoderma lucidum (5)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 cyclic ketone [CHEBI:3992] (644) 
 alicyclic ketone [CHEBI:36132] (68) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 aldehyde [CHEBI:17478] (258) 
 lucialdehyde B [CHEBI:66593] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 cyclic ketone [CHEBI:3992] (644) 
 alicyclic ketone [CHEBI:36132] (68) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 aldehyde [CHEBI:17478] (258) 
 lucialdehyde B [CHEBI:66593] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 triterpenoid [CHEBI:36615] (228) 
 tetracyclic triterpenoid [CHEBI:26893] (37) 
 lucialdehyde B [CHEBI:66593] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 triterpenoid [CHEBI:36615] (228) 
 tetracyclic triterpenoid [CHEBI:26893] (37) 
 lucialdehyde B [CHEBI:66593] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 cyclic ketone [CHEBI:3992] (644) 
 alicyclic ketone [CHEBI:36132] (68) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 aldehyde [CHEBI:17478] (258) 
 lucialdehyde B [CHEBI:66593] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 tetracyclic triterpenoid [CHEBI:26893] (37) 
 lucialdehyde B [CHEBI:66593] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 cyclic ketone [CHEBI:3992] (644) 
 alicyclic ketone [CHEBI:36132] (68) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 aldehyde [CHEBI:17478] (258) 
 lucialdehyde B [CHEBI:66593] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 tetracyclic triterpenoid [CHEBI:26893] (37) 
 lucialdehyde B [CHEBI:66593] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 tetracyclic triterpenoid [CHEBI:26893] (37) 
 lucialdehyde B [CHEBI:66593] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic polycyclic compound [CHEBI:51958] (1654) 
 tetracyclic triterpenoid [CHEBI:26893] (37) 
 lucialdehyde B [CHEBI:66593] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 terpene ketone [CHEBI:26872] (39) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 cyclic ketone [CHEBI:3992] (644) 
 alicyclic ketone [CHEBI:36132] (68) 
 cyclic terpene ketone [CHEBI:36130] (33) 
 lucialdehyde B [CHEBI:66593] (1)
 aldehyde [CHEBI:17478] (258) 
 lucialdehyde B [CHEBI:66593] (1)
ChEBI Compound Accession Identifier  [CHEBI:66593]
ChEBI Compound Description  A tetracyclic triterpenoid that is lanosta-8,24-dien-26-al substituted by oxo groups at positions 3 and 7. Isolated from Ganoderma lucidum and Ganoderma pfeifferi, it exhibits antiviral and cytotoxic activities.
ChEBI Compound Identification Number  66593
ChEBI InChI Value  InChI=1S/C30H44O3/c1-19(18-31)9-8-10-20(2)21-11-16-30(7)26-22(12-15-29(21,30)6)28(5)14-13-25(33)27(3,4)24(28)17-23(26)32/h9,18,20-21,24H,8,10-17H2,1-7H3/b19-9+/t20-,21-,24+,28-,29-,30+/m1/s1
ChEBI InChIKey Value  KZOBOICRKKYGAQ-GOUGDUPLSA-N
ChEBI Compound Name  lucialdehyde B
ChEBI SMILES Value  [H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@]1([H])CC3=O)[C@H](C)CC\C=C(/C)C=O
ChEBI Substance ID  160710131
ChEBI URL  ChEBI:66593
ChemSpider ID  8519327
Ontomatica Chemical Accession Key (OnChAKey)  KZOBOICRKKYGAQ_GOUGDUPLSA_N_000_000000
PubChem Compound ID  10343868