New Search

Item 1 of 33 (back to results)
next Next

amodiaquine
A quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820] > antimalarial [CHEBI:38068]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antimicrobial drug [CHEBI:36043] (169) 
 antiprotozoal drug [CHEBI:35820] (168) 
 antimalarial [CHEBI:38068] (89) 
 amodiaquine [CHEBI:2674] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 anti-inflammatory drug [CHEBI:35472] (112) 
 non-steroidal anti-inflammatory drug [CHEBI:35475] (71) 
 amodiaquine [CHEBI:2674] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 aromatic compound [CHEBI:33655] (3799) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 amodiaquine [CHEBI:2674] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 amodiaquine [CHEBI:2674] (1)
ChEBI Compound Accession Identifier  [CHEBI:2674]
ChEBI Compound Description  A quinoline having a chloro group at the 7-position and an aryl amino group at the 4-position.
ChEBI Compound Identification Number  2674
ChEBI InChI Value  InChI=1S/C20H22ClN3O/c1-3-24(4-2)13-14-11-16(6-8-20(14)25)23-18-9-10-22-19-12-15(21)5-7-17(18)19/h5-12,25H,3-4,13H2,1-2H3,(H,22,23)
ChEBI InChIKey Value  OVCDSSHSILBFBN-UHFFFAOYSA-N
ChEBI Compound Name  amodiaquine
ChEBI SMILES Value  CCN(CC)Cc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1O
ChEBI Substance ID  53801183
ChEBI URL  ChEBI:2674
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  OVCDSSHSILBFBN_UHFFFAOYSA_N_000_000000
PubChem Compound ID  2165