New Search

Item 1 of 1 (back to results)

L-dopa
An optically active form of dopa having L-configuration.


Current search:

03. Biological Effects of Specific Chemicals: growth regulator [CHEBI:39317] > plant growth regulator [CHEBI:26155] > plant growth retardant [CHEBI:35219] > L-dopa [CHEBI:15765]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 allelochemical [CHEBI:62215] (3) 
 L-dopa [CHEBI:15765] (1)
 aetiopathogenetic uses [CHEBI:52209] (178) 
 neurotoxin [CHEBI:50910] (26) 
 L-dopa [CHEBI:15765] (1)
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 dopaminergic agent [CHEBI:48560] (99) 
 L-dopa [CHEBI:15765] (1)
 hapten [CHEBI:59174] (92) 
 L-dopa [CHEBI:15765] (1)
 growth regulator [CHEBI:39317] (34) 
 plant growth regulator [CHEBI:26155] (21) 
 plant growth retardant [CHEBI:35219] (8) 
 L-dopa [CHEBI:15765] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 prodrug [CHEBI:50266] (88) 
 L-dopa [CHEBI:15765] (1)
 antidyskinesia agent [CHEBI:66956] (43) 
 L-dopa [CHEBI:15765] (1)
 antiparkinson drug [CHEBI:48407] (41) 
 L-dopa [CHEBI:15765] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 hydroxy-amino acid [CHEBI:24662] (65) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
 phenylalanine derivative [CHEBI:25985] (13) 
 hydroxyphenylalanine [CHEBI:24734] (3) 
 dopa [CHEBI:49168] (3) 
 L-dopa [CHEBI:15765] (1)
ChEBI Compound Accession Identifier  [CHEBI:15765]
ChEBI Compound Description  An optically active form of dopa having L-configuration.
ChEBI Compound Identification Number  15765
ChEBI InChI Value  InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1
ChEBI InChIKey Value  WTDRDQBEARUVNC-LURJTMIESA-N
ChEBI Compound Name  L-dopa
ChEBI SMILES Value  N[C@@H](Cc1ccc(O)c(O)c1)C(O)=O
ChEBI Substance ID  8143351
ChEBI URL  ChEBI:15765
ChemSpider ID  5824
Ontomatica Chemical Accession Key (OnChAKey)  WTDRDQBEARUVNC_LURJTMIESA_N_000_000000
PubChem Compound ID  6047