New Search

Item 1 of 1 (back to results)

roflumilast
A benzamide obtained by formal condensation of the carboxy group of 3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid with the amino group of 3,5-dichloropyridin-4-amine. Used for treatment of bronchial asthma and chronic obstructive pulmonary disease.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 phosphodiesterase inhibitor [CHEBI:50218] (17) 
 phosphodiesterase IV inhibitor [CHEBI:68844] (1) 
 roflumilast [CHEBI:47657] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 anti-asthmatic drug [CHEBI:49167] (25) 
 roflumilast [CHEBI:47657] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 fluorine molecular entity [CHEBI:24062] (288) 
 organofluorine compound [CHEBI:37143] (275) 
 roflumilast [CHEBI:47657] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organofluorine compound [CHEBI:37143] (275) 
 roflumilast [CHEBI:47657] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 roflumilast [CHEBI:47657] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 roflumilast [CHEBI:47657] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organofluorine compound [CHEBI:37143] (275) 
 roflumilast [CHEBI:47657] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 roflumilast [CHEBI:47657] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 roflumilast [CHEBI:47657] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 roflumilast [CHEBI:47657] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 roflumilast [CHEBI:47657] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 roflumilast [CHEBI:47657] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 roflumilast [CHEBI:47657] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 chloropyridine [CHEBI:39173] (4) 
 roflumilast [CHEBI:47657] (1)
 organofluorine compound [CHEBI:37143] (275) 
 roflumilast [CHEBI:47657] (1)
ChEBI Compound Accession Identifier  [CHEBI:47657]
ChEBI Compound Description  A benzamide obtained by formal condensation of the carboxy group of 3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid with the amino group of 3,5-dichloropyridin-4-amine. Used for treatment of bronchial asthma and chronic obstructive pulmonary disease.
ChEBI Compound Identification Number  47657
ChEBI InChI Value  InChI=1S/C17H14Cl2F2N2O3/c18-11-6-22-7-12(19)15(11)23-16(24)10-3-4-13(26-17(20)21)14(5-10)25-8-9-1-2-9/h3-7,9,17H,1-2,8H2,(H,22,23,24)
ChEBI InChIKey Value  MNDBXUUTURYVHR-UHFFFAOYSA-N
ChEBI Compound Name  roflumilast
ChEBI SMILES Value  FC(F)Oc1ccc(cc1OCC1CC1)C(=O)Nc1c(Cl)cncc1Cl
ChEBI Substance ID  160644734
ChEBI URL  ChEBI:47657
ChemSpider ID  395793
Ontomatica Chemical Accession Key (OnChAKey)  MNDBXUUTURYVHR_UHFFFAOYSA_N_000_000000
PubChem Compound ID  449193