more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, liver (18) |
|
|
Cattle, meat (59) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, liver (17) |
|
|
Goat, meat (56) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, liver (17) |
|
|
Horse, meat (54) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, liver (17) |
|
|
Sheep, meat (56) |
|
|
|
|
|
Avocado (23) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Snap bean (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 Subgroup 9A : Melon subgroup (5) |
|
|
|
|
|
Cucumber (12) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11-10 : Pome Fruit Group (5) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12-12 : Stone Fruit Group (1) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07F : Small fruit vine climbing (except fuzzy kiwifruit) subgroup (9) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fenpyroximate [CHEBI:5011] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:5011] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
5011 |
ChEBI InChI Value: |
InChI=1S/C24H27N3O4/c1-17-21(22(27(5)26-17)30-20-9-7-6-8-10-20)15-25-29-16-18-11-13-19(14-12-18)23(28)31-24(2,3)4/h6-15H,16H2,1-5H3/b25-15+ |
ChEBI InChIKey Value: |
YYJNOYZRYGDPNH-MFKUBSTISA-N |
ChEBI Compound Name: |
fenpyroximate |
ChEBI SMILES Value: |
Cc1nn(C)c(Oc2ccccc2)c1\C=N\OCc1ccc(cc1)C(=O)OC(C)(C)C |
ChEBI Substance ID: |
24775696 |
ChEBI URL: |
ChEBI:5011 |
ChemSpider ID: |
7850857 |
Ontomatica Chemical Accession Key (OnChAKey): |
YYJNOYZRYGDPNH_MFKUBSTISA_N_000_000000 |
PubChem Compound ID: |
9576412 |