New Search

Item 2 of 98 (back to results)
Previous previous next Next

aloin A
A C-glycosyl compound that is beta-D-glucopyranose in which the anomeric hydroxy group is replaced by a 4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl moiety (the 9S diastereoisomer).


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 aloin A [CHEBI:2991] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 laxative [CHEBI:50503] (9) 
 aloin A [CHEBI:2991] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 aloin A [CHEBI:2991] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 C-glycosyl compound [CHEBI:20857] (52) 
 aloin A [CHEBI:2991] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 C-glycosyl compound [CHEBI:20857] (52) 
 aloin A [CHEBI:2991] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 aloin A [CHEBI:2991] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 C-glycosyl compound [CHEBI:20857] (52) 
 aloin A [CHEBI:2991] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 C-glycosyl compound [CHEBI:20857] (52) 
 aloin A [CHEBI:2991] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 aloin A [CHEBI:2991] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 C-glycosyl compound [CHEBI:20857] (52) 
 aloin A [CHEBI:2991] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 C-glycosyl compound [CHEBI:20857] (52) 
 aloin A [CHEBI:2991] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 aloin A [CHEBI:2991] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 acenes [CHEBI:51269] (110) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 carbotricyclic compound [CHEBI:38032] (198) 
 anthracenes [CHEBI:46955] (90) 
 aloin A [CHEBI:2991] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 aloin A [CHEBI:2991] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 aloin A [CHEBI:2991] (1)
ChEBI Compound Accession Identifier  [CHEBI:2991]
ChEBI Compound Description  A C-glycosyl compound that is beta-D-glucopyranose in which the anomeric hydroxy group is replaced by a 4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl moiety (the 9S diastereoisomer).
ChEBI Compound Identification Number  2991
ChEBI InChI Value  InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14+,17-,19+,20-,21+/m1/s1
ChEBI InChIKey Value  AFHJQYHRLPMKHU-OSYMLPPYSA-N
ChEBI Compound Name  aloin A
ChEBI SMILES Value  [H][C@]1(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@]1([H])c2cccc(O)c2C(=O)c2c(O)cc(CO)cc12
ChEBI Substance ID  163626646
ChEBI URL  ChEBI:2991
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  AFHJQYHRLPMKHU_OSYMLPPYSA_N_000_000000
PubChem Compound ID  12305761