Item 2 of 13 (back to results) previous next haloperidol "A compound composed of a central piperidine structure with hydroxy and p-chlorophenyl substituents at position 4; and an N-linked p-fluorobutyrophenone moiety."

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > organic cyclic compound [CHEBI:33832] > organic heterocyclic compound [CHEBI:24532] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antidyskinesia agent [CHEBI:66956] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   serotonergic drug [CHEBI:48278] (109)   serotonergic antagonist [CHEBI:48279] (52)   haloperidol [CHEBI:5613] (1)  dopaminergic agent [CHEBI:48560] (99)   dopaminergic antagonist [CHEBI:48561] (48)   haloperidol [CHEBI:5613] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   antipsychotic agent [CHEBI:35476] (51)   first generation antipsychotic [CHEBI:65190] (30)   haloperidol [CHEBI:5613] (1)  antiemetic [CHEBI:50919] (41)   haloperidol [CHEBI:5613] (1)  antidyskinesia agent [CHEBI:66956] (43)   haloperidol [CHEBI:5613] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   haloperidol [CHEBI:5613] (1)  fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   haloperidol [CHEBI:5613] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   haloperidol [CHEBI:5613] (1)  organofluorine compound [CHEBI:37143] (275)   haloperidol [CHEBI:5613] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   haloperidol [CHEBI:5613] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   haloperidol [CHEBI:5613] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   haloperidol [CHEBI:5613] (1)  organofluorine compound [CHEBI:37143] (275)   haloperidol [CHEBI:5613] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   haloperidol [CHEBI:5613] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   haloperidol [CHEBI:5613] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   hydroxypiperidine [CHEBI:48590] (8)   haloperidol [CHEBI:5613] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   haloperidol [CHEBI:5613] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   haloperidol [CHEBI:5613] (1)  organofluorine compound [CHEBI:37143] (275)   haloperidol [CHEBI:5613] (1) ChEBI Compound Accession Identifier:   [CHEBI:5613] ChEBI Compound Description:   "A compound composed of a central piperidine structure with hydroxy and p-chlorophenyl substituents at position 4; and an N-linked p-fluorobutyrophenone moiety." ChEBI Compound Identification Number:   5613 ChEBI InChI Value:   InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 ChEBI InChIKey Value:   LNEPOXFFQSENCJ-UHFFFAOYSA-N ChEBI Compound Name:   haloperidol ChEBI SMILES Value:   OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c1ccc(Cl)cc1 ChEBI Substance ID:   46530521 ChEBI URL:   ChEBI:5613 ChemSpider ID:   3438 Ontomatica Chemical Accession Key (OnChAKey):   LNEPOXFFQSENCJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3559