New Search

Item 2 of 66 (back to results)
Previous previous next Next

azatadine
A benzo[5,6]cyclohepta[1,2-b]pyridine having a 1-methylpiperidin-4-ylidene group at the 11-position.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > histaminergic drug [CHEBI:37957] > histamine antagonist [CHEBI:37956]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 histaminergic drug [CHEBI:37957] (94) 
 histamine antagonist [CHEBI:37956] (87) 
 H1-receptor antagonist [CHEBI:37955] (57) 
 azatadine [CHEBI:2946] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 anti-allergic agent [CHEBI:50857] (51) 
 azatadine [CHEBI:2946] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 azatadine [CHEBI:2946] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 azatadine [CHEBI:2946] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 azatadine [CHEBI:2946] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 azatadine [CHEBI:2946] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 azatadine [CHEBI:2946] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 azatadine [CHEBI:2946] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 benzocycloheptapyridine [CHEBI:48593] (3) 
 azatadine [CHEBI:2946] (1)
ChEBI Compound Accession Identifier  [CHEBI:2946]
ChEBI Compound Description  A benzo[5,6]cyclohepta[1,2-b]pyridine having a 1-methylpiperidin-4-ylidene group at the 11-position.
ChEBI Compound Identification Number  2946
ChEBI InChI Value  InChI=1S/C20H22N2/c1-22-13-10-16(11-14-22)19-18-7-3-2-5-15(18)8-9-17-6-4-12-21-20(17)19/h2-7,12H,8-11,13-14H2,1H3
ChEBI InChIKey Value  SEBMTIQKRHYNIT-UHFFFAOYSA-N
ChEBI Compound Name  azatadine
ChEBI SMILES Value  CN1CCC(CC1)=C1c2ccccc2CCc2cccnc12
ChEBI Substance ID  87350405
ChEBI URL  ChEBI:2946
ChemSpider ID  18709
Ontomatica Chemical Accession Key (OnChAKey)  SEBMTIQKRHYNIT_UHFFFAOYSA_N_000_000000
PubChem Compound ID  19861