Item 2 of 3 (back to results) previous next CGP 78608 A phosphonic acid in which the hydrogen attached to phosphorous is substituted by a 1-{[(7-bromo-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]amino}ethyl group. Potent and selective NMDA antagonist that acts through the glycine site (IC50 = 5 nM). Displays >500-fold selectivity over kainate and AMPA receptors (IC50 values are 2.7 and 3 muM respectively). Anticonvulsant in vivo following systemic administration.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > antagonist [CHEBI:48706] > excitatory amino acid antagonist [CHEBI:60798] > NMDA receptor antagonist [CHEBI:60797] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > central nervous system depressant [CHEBI:35488] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   antagonist [CHEBI:48706] (126)   excitatory amino acid antagonist [CHEBI:60798] (23)   NMDA receptor antagonist [CHEBI:60797] (21)   CGP 78608 [CHEBI:64061] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   central nervous system depressant [CHEBI:35488] (90)   anticonvulsant [CHEBI:35623] (39)   CGP 78608 [CHEBI:64061] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   CGP 78608 [CHEBI:64061] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   CGP 78608 [CHEBI:64061] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   phosphorus molecular entity [CHEBI:26082] (2769)   phosphorus oxoacids and derivatives [CHEBI:36360] (2691)   phosphonic acids [CHEBI:26069] (25)   CGP 78608 [CHEBI:64061] (1)  nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   CGP 78608 [CHEBI:64061] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   CGP 78608 [CHEBI:64061] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   CGP 78608 [CHEBI:64061] (1)  organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   CGP 78608 [CHEBI:64061] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   CGP 78608 [CHEBI:64061] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   CGP 78608 [CHEBI:64061] (1) ChEBI Compound Accession Identifier:   [CHEBI:64061] ChEBI Compound Description:   A phosphonic acid in which the hydrogen attached to phosphorous is substituted by a 1-{[(7-bromo-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]amino}ethyl group. Potent and selective NMDA antagonist that acts through the glycine site (IC50 = 5 nM). Displays >500-fold selectivity over kainate and AMPA receptors (IC50 values are 2.7 and 3 muM respectively). Anticonvulsant in vivo following systemic administration. ChEBI Compound Identification Number:   64061 ChEBI InChI Value:   InChI=1S/C11H13BrN3O5P/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20)/t5-/m0/s1 ChEBI InChIKey Value:   DPFHVUSPVHRVFL-YFKPBYRVSA-N ChEBI Compound Name:   CGP 78608 ChEBI SMILES Value:   C[C@@H](NCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)P(O)(O)=O ChEBI Substance ID:   135610872 ChEBI URL:   ChEBI:64061 ChemSpider ID:   5037131 Ontomatica Chemical Accession Key (OnChAKey):   DPFHVUSPVHRVFL_YFKPBYRVSA_N_000_000000 PubChem Compound ID:   6604872