New Search

Item 11 of 907 (back to results)
Previous previous next Next

apramycin
An aminoglycoside that is 2-deoxystreptamine that is substituted on the oxygen at position 4 by an (8R)-2-amino-8-O-(4-amino-4-deoxy-alpha-D-glucopyranosyl)-2,3,7-trideoxy-7-(methylamino)-D-glycero-alpha-D-allo-octodialdo-1,5:8,4-dipyranos-1-yl) group.


Current search:

08. Chemical Category: main group molecular entity [CHEBI:33579]
×
03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antibiotic [CHEBI:22582] (193) 
 apramycin [CHEBI:2790] (1)
 antibacterial agent [CHEBI:33282] (317) 
 antibacterial drug [CHEBI:36047] (177) 
 apramycin [CHEBI:2790] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 cyclitol [CHEBI:23451] (149) 
 amino cyclitol [CHEBI:61689] (9) 
 2-deoxystreptamine derivative [CHEBI:61800] (1) 
 apramycin [CHEBI:2790] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 cyclitol [CHEBI:23451] (149) 
 amino cyclitol [CHEBI:61689] (9) 
 2-deoxystreptamine derivative [CHEBI:61800] (1) 
 apramycin [CHEBI:2790] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 glycosyl compound [CHEBI:63161] (1006) 
 glycoside [CHEBI:24400] (633) 
 aminoglycoside [CHEBI:47779] (66) 
 apramycin [CHEBI:2790] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 aminoglycoside [CHEBI:47779] (66) 
 apramycin [CHEBI:2790] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 glycosyl compound [CHEBI:63161] (1006) 
 glycoside [CHEBI:24400] (633) 
 aminoglycoside [CHEBI:47779] (66) 
 apramycin [CHEBI:2790] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 aminoglycoside [CHEBI:47779] (66) 
 apramycin [CHEBI:2790] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 glycosyl compound [CHEBI:63161] (1006) 
 glycoside [CHEBI:24400] (633) 
 aminoglycoside [CHEBI:47779] (66) 
 apramycin [CHEBI:2790] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 aminoglycoside [CHEBI:47779] (66) 
 apramycin [CHEBI:2790] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 cyclitol [CHEBI:23451] (149) 
 amino cyclitol [CHEBI:61689] (9) 
 2-deoxystreptamine derivative [CHEBI:61800] (1) 
 apramycin [CHEBI:2790] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 apramycin [CHEBI:2790] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 polyol [CHEBI:26191] (437) 
 cyclitol [CHEBI:23451] (149) 
 amino cyclitol [CHEBI:61689] (9) 
 2-deoxystreptamine derivative [CHEBI:61800] (1) 
 apramycin [CHEBI:2790] (1)
ChEBI Compound Accession Identifier  [CHEBI:2790]
ChEBI Compound Description  An aminoglycoside that is 2-deoxystreptamine that is substituted on the oxygen at position 4 by an (8R)-2-amino-8-O-(4-amino-4-deoxy-alpha-D-glucopyranosyl)-2,3,7-trideoxy-7-(methylamino)-D-glycero-alpha-D-allo-octodialdo-1,5:8,4-dipyranos-1-yl) group.
ChEBI Compound Identification Number  2790
ChEBI InChI Value  InChI=1S/C21H41N5O11/c1-26-11-14(30)18-8(33-20(11)37-21-16(32)13(29)10(25)9(4-27)34-21)3-7(24)19(36-18)35-17-6(23)2-5(22)12(28)15(17)31/h5-21,26-32H,2-4,22-25H2,1H3/t5-,6+,7-,8+,9-,10-,11+,12+,13+,14-,15-,16-,17-,18+,19+,20-,21-/m1/s1
ChEBI InChIKey Value  XZNUGFQTQHRASN-XQENGBIVSA-N
ChEBI Compound Name  apramycin
ChEBI SMILES Value  [H][C@]12C[C@@H](N)[C@@H](O[C@@H]3[C@@H](N)C[C@@H](N)[C@H](O)[C@H]3O)O[C@]1([H])[C@H](O)[C@H](NC)[C@@H](O[C@H]1O[C@H](CO)[C@@H](N)[C@H](O)[C@H]1O)O2
ChEBI Substance ID  121269842
ChEBI URL  ChEBI:2790
ChemSpider ID  2339128
Ontomatica Chemical Accession Key (OnChAKey)  XZNUGFQTQHRASN_XQENGBIVSA_N_000_000000
PubChem Compound ID  3081545