Item 11 of 2225 (back to results) previous next astechrome An iron(III) hydroxamate based pigment isolated from Aspergillus terreus and later found in Aspergillus fumigatus.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   astechrome [CHEBI:73877] (1) 08. Chemical Category  08. Chemical Category  transition element molecular entity [CHEBI:33497] (536)   d-block molecular entity [CHEBI:33676] (500)   iron group molecular entity [CHEBI:33744] (115)   iron molecular entity [CHEBI:24873] (96)   iron coordination entity [CHEBI:33892] (92)   iron chelate [CHEBI:5975] (6)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  transition element coordination entity [CHEBI:33861] (358)   iron coordination entity [CHEBI:33892] (92)   iron chelate [CHEBI:5975] (6)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   hydroxamate [CHEBI:24648] (2)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   hydroxamate [CHEBI:24648] (2)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   hydroxamate [CHEBI:24648] (2)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   hydroxamate [CHEBI:24648] (2)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   hydroxamate [CHEBI:24648] (2)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   hydroxamic acid [CHEBI:24650] (25)   hydroxamate [CHEBI:24648] (2)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  diazines [CHEBI:38313] (288)   pyrazines [CHEBI:38314] (15)   astechrome [CHEBI:73877] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   astechrome [CHEBI:73877] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   coordination entity [CHEBI:33240] (498)   transition element coordination entity [CHEBI:33861] (358)   iron coordination entity [CHEBI:33892] (92)   iron chelate [CHEBI:5975] (6)   iron(III) hydroxamate [CHEBI:28163] (2)   astechrome [CHEBI:73877] (1) ChEBI Compound Accession Identifier:   [CHEBI:73877] ChEBI Compound Description:   An iron(III) hydroxamate based pigment isolated from Aspergillus terreus and later found in Aspergillus fumigatus. ChEBI Compound Identification Number:   73877 ChEBI InChI Value:   "InChI=1S/3C20H22N3O3.Fe/c3*1-12(2)8-9-14-6-5-7-16-15(11-21-18(14)16)10-17-19(26-4)22-13(3)20(24)23(17)25;/h3*5-8,11,21H,9-10H2,1-4H3;/q3*-1;+3" ChEBI InChIKey Value:   OEPBYEBLOCELCQ-UHFFFAOYSA-N ChEBI Compound Name:   astechrome ChEBI SMILES Value:   COC1=C(Cc2c[nH]c3c(CC=C(C)C)cccc23)N2O[Fe-3]34(ON5C(Cc6c[nH]c7c(CC=C(C)C)cccc67)=C(OC)N=C(C)C5=[O+]3)(ON3C(Cc5c[nH]c6c(CC=C(C)C)cccc56)=C(OC)N=C(C)C3=[O+]4)[O+]=C2C(C)=N1 ChEBI Substance ID:   163626836 ChEBI URL:   ChEBI:73877 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   OEPBYEBLOCELCQ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   71581088