Item 11 of 34 (back to results) previous next atropine A tropane alkaloid obtained from deadly nightshade (Atropa belladonna) and other plants of the family Solanaceae.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > bronchodilator agent [CHEBI:35523] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   cholinergic drug [CHEBI:38323] (108)   cholinergic antagonist [CHEBI:48873] (84)   muscarinic antagonist [CHEBI:48876] (61)   atropine [CHEBI:16684] (1)  parasympatholytic [CHEBI:50370] (17)   atropine [CHEBI:16684] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   mydriatic agent [CHEBI:50513] (6)   atropine [CHEBI:16684] (1)  bronchodilator agent [CHEBI:35523] (34)   atropine [CHEBI:16684] (1)  cardiovascular drug [CHEBI:35554] (162)   anti-arrhythmia drug [CHEBI:38070] (56)   atropine [CHEBI:16684] (1)  adjuvant [CHEBI:60809] (12)   anaesthesia adjuvant [CHEBI:60807] (10)   atropine [CHEBI:16684] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   atropine [CHEBI:16684] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   atropine [CHEBI:16684] (3)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   atropine [CHEBI:16684] (3)  ester [CHEBI:35701] (3370)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   atropine [CHEBI:16684] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   atropine [CHEBI:16684] (3)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   tropane alkaloid [CHEBI:37332] (17)   atropine [CHEBI:16684] (3)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   propanoate ester [CHEBI:36243] (13)   atropine [CHEBI:16684] (3) ChEBI Compound Accession Identifier:   [CHEBI:16684] ChEBI Compound Description:   A tropane alkaloid obtained from deadly nightshade (Atropa belladonna) and other plants of the family Solanaceae. ChEBI Compound Identification Number:   16684 ChEBI InChI Value:   InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16? ChEBI InChIKey Value:   RKUNBYITZUJHSG-SPUOUPEWSA-N ChEBI Compound Name:   atropine ChEBI SMILES Value:   CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)c1ccccc1 ChEBI Substance ID:   8144950 ChEBI URL:   ChEBI:16684 ChemSpider ID:   10194105 Ontomatica Chemical Accession Key (OnChAKey):   RKUNBYITZUJHSG_SPUOUPEWSA_N_000_000000 PubChem Compound ID:   174174