Item 12 of 13 (back to results) previous next caldariellaquinone A 1-benzothiophene that is 1-benzothiophene-4,7-dione bearing additional methylthio and 3,7,11,15,19,23-hexamethyltetracosyl substituents at positions 5 and 6 respectively. Isolated from Caldariella acidophila.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > sulfur molecular entity [CHEBI:26835] > organosulfur compound [CHEBI:33261] > organosulfur heterocyclic compound [CHEBI:38106] > benzothiophenes [CHEBI:38767] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   caldariellaquinone [CHEBI:73387] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   caldariellaquinone [CHEBI:73387] (1)  sulfur molecular entity [CHEBI:26835] (1541)   sulfide [CHEBI:26822] (86)   organic sulfide [CHEBI:16385] (82)   caldariellaquinone [CHEBI:73387] (1)  organosulfur compound [CHEBI:33261] (1005)   organic sulfide [CHEBI:16385] (82)   caldariellaquinone [CHEBI:73387] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organic sulfide [CHEBI:16385] (82)   caldariellaquinone [CHEBI:73387] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   caldariellaquinone [CHEBI:73387] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organic sulfide [CHEBI:16385] (82)   caldariellaquinone [CHEBI:73387] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   caldariellaquinone [CHEBI:73387] (1)  quinone [CHEBI:36141] (209)   caldariellaquinone [CHEBI:73387] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   caldariellaquinone [CHEBI:73387] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiophenes [CHEBI:38767] (13)   1-benzothiophenes [CHEBI:38836] (11)   caldariellaquinone [CHEBI:73387] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   caldariellaquinone [CHEBI:73387] (1) ChEBI Compound Accession Identifier:   [CHEBI:73387] ChEBI Compound Description:   A 1-benzothiophene that is 1-benzothiophene-4,7-dione bearing additional methylthio and 3,7,11,15,19,23-hexamethyltetracosyl substituents at positions 5 and 6 respectively. Isolated from Caldariella acidophila. ChEBI Compound Identification Number:   73387 ChEBI InChI Value:   InChI=1S/C39H66O2S2/c1-28(2)14-9-15-29(3)16-10-17-30(4)18-11-19-31(5)20-12-21-32(6)22-13-23-33(7)24-25-34-37(41)39-35(26-27-43-39)36(40)38(34)42-8/h26-33H,9-25H2,1-8H3 ChEBI InChIKey Value:   GHRWXPXOBGRSHG-UHFFFAOYSA-N ChEBI Compound Name:   caldariellaquinone ChEBI SMILES Value:   CSC1=C(CCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C)C(=O)c2sccc2C1=O ChEBI Substance ID:   163425728 ChEBI URL:   ChEBI:73387 ChemSpider ID:   168476 Ontomatica Chemical Accession Key (OnChAKey):   GHRWXPXOBGRSHG_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   194166