Item 12 of 18 (back to results) previous next neopyrrolomycin B A member of the class of trichlorophenols that is 3,4,5-trichlorophenol substituted by a 2,3,4-trichloro-1H-pyrrolyl moiety at position 2. It is isolated from the fermentation broth of Streptomyces and exbits broad-spectrum antibacterial activity against a panel of pathogens including variety of drug-susceptible and drug-resistant phenotypes.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > halogen molecular entity [CHEBI:24471] > halide [CHEBI:37578] × 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antibiotic [CHEBI:22582] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   neopyrrolomycin B [CHEBI:66615] (1)  antimicrobial agent [CHEBI:33281] (927)   antibiotic [CHEBI:22582] (193)   neopyrrolomycin B [CHEBI:66615] (1)  antibacterial agent [CHEBI:33282] (317)   neopyrrolomycin B [CHEBI:66615] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Eubacteria (239)   Firmicutes (214)   Actinobacteria (204)   Actinobacteridae (204)   Actinomycetales (204)   Streptomycetaceae (160)   Streptomyces (157) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  mancude ring [CHEBI:35568] (488)   organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   monocyclic heteroarene [CHEBI:38179] (375)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   halophenol [CHEBI:38856] (19)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1)  hydrides [CHEBI:33692] (1374)   organic hydride [CHEBI:37175] (1178)   organic fundamental parent [CHEBI:33245] (1178)   heterocyclic organic fundamental parent [CHEBI:35552] (537)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  organic mancude parent [CHEBI:35573] (488)   mancude organic heterocyclic parent [CHEBI:35571] (481)   mancude organic heteromonocyclic parent [CHEBI:35555] (392)   azole [CHEBI:68452] (357)   pyrroles [CHEBI:26455] (40)   neopyrrolomycin B [CHEBI:66615] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chlorophenol [CHEBI:23150] (9)   trichlorophenols [CHEBI:15258] (3)   neopyrrolomycin B [CHEBI:66615] (1) ChEBI Compound Accession Identifier:   [CHEBI:66615] ChEBI Compound Description:   A member of the class of trichlorophenols that is 3,4,5-trichlorophenol substituted by a 2,3,4-trichloro-1H-pyrrolyl moiety at position 2. It is isolated from the fermentation broth of Streptomyces and exbits broad-spectrum antibacterial activity against a panel of pathogens including variety of drug-susceptible and drug-resistant phenotypes. ChEBI Compound Identification Number:   66615 ChEBI InChI Value:   InChI=1S/C10H3Cl6NO/c11-3-1-5(18)9(8(15)6(3)13)17-2-4(12)7(14)10(17)16/h1-2,18H ChEBI InChIKey Value:   NTKHEOJBPXFULD-UHFFFAOYSA-N ChEBI Compound Name:   neopyrrolomycin B ChEBI SMILES Value:   Oc1cc(Cl)c(Cl)c(Cl)c1-n1cc(Cl)c(Cl)c1Cl ChEBI Substance ID:   160645512 ChEBI URL:   ChEBI:66615 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   NTKHEOJBPXFULD_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   25227595