New Search

Item 12 of 15 (back to results)
Previous previous next Next

tunicamycin C1
A nucleoside that is one of the homologues in the mixture that is tunicamycin, characterised by a 14-methylpentadec-2-enoyl fatty acyl substituent on the amino group of the tunicamine moiety.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antibiotic [CHEBI:22582]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antibiotic [CHEBI:22582] (193) 
 tunicamycin C1 [CHEBI:64256] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 glycosyl compound [CHEBI:63161] (1006) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 carbohydrate derivative [CHEBI:63299] (2582) 
 N-glycosyl compound [CHEBI:21731] (294) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 nucleobase-containing molecular entity [CHEBI:61120] (573) 
 nucleoside [CHEBI:33838] (227) 
 tunicamycin C1 [CHEBI:64256] (1)
ChEBI Compound Accession Identifier  [CHEBI:64256]
ChEBI Compound Description  A nucleoside that is one of the homologues in the mixture that is tunicamycin, characterised by a 14-methylpentadec-2-enoyl fatty acyl substituent on the amino group of the tunicamine moiety.
ChEBI Compound Identification Number  64256
ChEBI InChI Value  InChI=1S/C39H64N4O16/c1-20(2)14-12-10-8-6-4-5-7-9-11-13-15-25(47)41-28-32(52)29(49)23(56-38(28)59-37-27(40-21(3)45)31(51)30(50)24(19-44)57-37)18-22(46)35-33(53)34(54)36(58-35)43-17-16-26(48)42-39(43)55/h13,15-17,20,22-24,27-38,44,46,49-54H,4-12,14,18-19H2,1-3H3,(H,40,45)(H,41,47)(H,42,48,55)/b15-13+/t22-,23-,24-,27-,28-,29+,30-,31-,32-,33+,34-,35-,36-,37-,38+/m1/s1
ChEBI InChIKey Value  ZOCXUHJGZXXIGQ-NPXWYGMKSA-N
ChEBI Compound Name  tunicamycin C1
ChEBI SMILES Value  [H][C@@](O)(C[C@H]1O[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@H](NC(=O)\C=C\CCCCCCCCCCC(C)C)[C@@H](O)[C@H]1O)[C@@]1([H])O[C@H]([C@H](O)[C@@H]1O)n1ccc(=O)[nH]c1=O
ChEBI Substance ID  135610631
ChEBI URL  ChEBI:64256
ChemSpider ID  27471426
Ontomatica Chemical Accession Key (OnChAKey)  ZOCXUHJGZXXIGQ_NPXWYGMKSA_N_000_000000
PubChem Compound ID  56927836