Item 13 of 23 (back to results) previous next 1,3-benzothiazole-2-thiol 1,3-Benzothiazole substituted at the 2-position with a sulfanyl group.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] × 03. Biological Effects of Specific Chemicals: aetiopathogenetic uses [CHEBI:52209] > carcinogenic agent [CHEBI:50903] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  aetiopathogenetic uses [CHEBI:52209] (178)   carcinogenic agent [CHEBI:50903] (40)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   thiol [CHEBI:29256] (31)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   thiol [CHEBI:29256] (31)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   thiol [CHEBI:29256] (31)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   1,3-benzothiazole-2-thiol [CHEBI:34292] (1) ChEBI Compound Accession Identifier:   [CHEBI:34292] ChEBI Compound Description:   1,3-Benzothiazole substituted at the 2-position with a sulfanyl group. ChEBI Compound Identification Number:   34292 ChEBI InChI Value:   InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) ChEBI InChIKey Value:   YXIWHUQXZSMYRE-UHFFFAOYSA-N ChEBI Compound Name:   1,3-benzothiazole-2-thiol ChEBI SMILES Value:   Sc1nc2ccccc2s1 ChEBI Substance ID:   85240163 ChEBI URL:   ChEBI:34292 ChemSpider ID:   608157 Ontomatica Chemical Accession Key (OnChAKey):   YXIWHUQXZSMYRE_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   697993