| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean (edible-podded) (2) | 
 | 
| 
 | 
 Bean (edible-podded) (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean, succulent (18) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 09 Subgroup 9A : Melon subgroup (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07F : Small fruit vine climbing (except fuzzy kiwifruit) subgroup (9) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pistachio (28) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cowpea, forage (5) | 
 | 
| 
 | 
 Cowpea, hay (6) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 acequinocyl [CHEBI:38592] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:38592] | 
| ChEBI Compound Description:  | 
 An acetate ester consisting of 1,4-naphthoquinone bearing acetoxy and dodecyl substituents at positions 2 and 3 respectively. | 
| ChEBI Compound Identification Number:  | 
 38592 | 
| ChEBI InChI Value:  | 
 InChI=1S/C24H32O4/c1-3-4-5-6-7-8-9-10-11-12-17-21-22(26)19-15-13-14-16-20(19)23(27)24(21)28-18(2)25/h13-16H,3-12,17H2,1-2H3 | 
| ChEBI InChIKey Value:  | 
 QDRXWCAVUNHOGA-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 acequinocyl | 
| ChEBI SMILES Value:  | 
 CCCCCCCCCCCCC1=C(OC(C)=O)C(=O)c2ccccc2C1=O | 
| ChEBI Substance ID:  | 
 24775808 | 
| ChEBI URL:  | 
 ChEBI:38592 | 
| ChemSpider ID:  | 
 84245 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 QDRXWCAVUNHOGA_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 93315 |