New Search

Item 13 of 19 (back to results)
Previous previous next Next

CGP 78608
A phosphonic acid in which the hydrogen attached to phosphorous is substituted by a 1-{[(7-bromo-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]amino}ethyl group. Potent and selective NMDA antagonist that acts through the glycine site (IC50 = 5 nM). Displays >500-fold selectivity over kainate and AMPA receptors (IC50 values are 2.7 and 3 muM respectively). Anticonvulsant in vivo following systemic administration.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > antagonist [CHEBI:48706] > excitatory amino acid antagonist [CHEBI:60798] > NMDA receptor antagonist [CHEBI:60797]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 antagonist [CHEBI:48706] (126) 
 excitatory amino acid antagonist [CHEBI:60798] (23) 
 NMDA receptor antagonist [CHEBI:60797] (21) 
 CGP 78608 [CHEBI:64061] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 central nervous system depressant [CHEBI:35488] (90) 
 anticonvulsant [CHEBI:35623] (39) 
 CGP 78608 [CHEBI:64061] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 bromine molecular entity [CHEBI:22928] (199) 
 organobromine compound [CHEBI:37141] (138) 
 CGP 78608 [CHEBI:64061] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 CGP 78608 [CHEBI:64061] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 phosphorus molecular entity [CHEBI:26082] (2769) 
 phosphorus oxoacids and derivatives [CHEBI:36360] (2691) 
 phosphonic acids [CHEBI:26069] (25) 
 CGP 78608 [CHEBI:64061] (1)
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 CGP 78608 [CHEBI:64061] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 CGP 78608 [CHEBI:64061] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 CGP 78608 [CHEBI:64061] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 CGP 78608 [CHEBI:64061] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 CGP 78608 [CHEBI:64061] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 CGP 78608 [CHEBI:64061] (1)
ChEBI Compound Accession Identifier  [CHEBI:64061]
ChEBI Compound Description  A phosphonic acid in which the hydrogen attached to phosphorous is substituted by a 1-{[(7-bromo-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]amino}ethyl group. Potent and selective NMDA antagonist that acts through the glycine site (IC50 = 5 nM). Displays >500-fold selectivity over kainate and AMPA receptors (IC50 values are 2.7 and 3 muM respectively). Anticonvulsant in vivo following systemic administration.
ChEBI Compound Identification Number  64061
ChEBI InChI Value  InChI=1S/C11H13BrN3O5P/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20)/t5-/m0/s1
ChEBI InChIKey Value  DPFHVUSPVHRVFL-YFKPBYRVSA-N
ChEBI Compound Name  CGP 78608
ChEBI SMILES Value  C[C@@H](NCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)P(O)(O)=O
ChEBI Substance ID  135610872
ChEBI URL  ChEBI:64061
ChemSpider ID  5037131
Ontomatica Chemical Accession Key (OnChAKey)  DPFHVUSPVHRVFL_YFKPBYRVSA_N_000_000000
PubChem Compound ID  6604872