New Search

Item 14 of 32 (back to results)
Previous previous next Next

BE-54238A
An organic heteropentacyclic compound that is isolated from Streptomyces sp. A54238. It exhibits inhibitory efficacy against the growth of human tumour cells.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 BE-54238A [CHEBI:65475] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antibiotic [CHEBI:22582] (193) 
 BE-54238A [CHEBI:65475] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 BE-54238A [CHEBI:65475] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Archaea, Cyanobacteria and Bacteria (302) 
 Eubacteria (239) 
 Firmicutes (214) 
 Actinobacteria (204) 
 Actinobacteridae (204) 
 Actinomycetales (204) 
 Streptomycetaceae (160) 
 Streptomyces (157)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 BE-54238A [CHEBI:65475] (1)
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 BE-54238A [CHEBI:65475] (1)
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 BE-54238A [CHEBI:65475] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 BE-54238A [CHEBI:65475] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 BE-54238A [CHEBI:65475] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 BE-54238A [CHEBI:65475] (1)
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 BE-54238A [CHEBI:65475] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 BE-54238A [CHEBI:65475] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 BE-54238A [CHEBI:65475] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 BE-54238A [CHEBI:65475] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 BE-54238A [CHEBI:65475] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 oxo carboxylic acid [CHEBI:25754] (273) 
 oxo monocarboxylic acid [CHEBI:35871] (198) 
 BE-54238A [CHEBI:65475] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 BE-54238A [CHEBI:65475] (1)
 phenols [CHEBI:33853] (868) 
 BE-54238A [CHEBI:65475] (1)
ChEBI Compound Accession Identifier  [CHEBI:65475]
ChEBI Compound Description  An organic heteropentacyclic compound that is isolated from Streptomyces sp. A54238. It exhibits inhibitory efficacy against the growth of human tumour cells.
ChEBI Compound Identification Number  65475
ChEBI InChI Value  InChI=1S/C22H23NO6/c1-9(24)14-4-5-15-12-3-6-16(25)20-19(12)21(23(14)15)13-7-11(8-17(26)27)29-10(2)18(13)22(20)28/h3,6,9-11,14,24,28H,4-5,7-8H2,1-2H3,(H,26,27)
ChEBI InChIKey Value  AWMWNWIBOOYESP-UHFFFAOYSA-N
ChEBI Compound Name  BE-54238A
ChEBI SMILES Value  CC(O)C1CCc2c3C=CC(=O)c4c(O)c5C(C)OC(CC(O)=O)Cc5c(n12)c34
ChEBI Substance ID  160644828
ChEBI URL  ChEBI:65475
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  AWMWNWIBOOYESP_UHFFFAOYSA_N_000_000000
PubChem Compound ID  9930678