New Search

Item 15 of 597 (back to results)
Previous previous next Next

onosmin B
A benzoate ester obtained by the fromal condensation of the carboxy group of onosmin A with methanol. Isolated from Onosma hispida, it exhibits inhibitory activity against lipoxygenase.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 lipoxygenase inhibitor [CHEBI:35856] (23) 
 onosmin B [CHEBI:66822] (1)
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 onosmin B [CHEBI:66822] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 onosmin B [CHEBI:66822] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 onosmin B [CHEBI:66822] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 aromatic ester [CHEBI:62732] (94) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 onosmin B [CHEBI:66822] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 aromatic compound [CHEBI:33655] (3799) 
 aromatic ester [CHEBI:62732] (94) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 onosmin B [CHEBI:66822] (1)
ChEBI Compound Accession Identifier  [CHEBI:66822]
ChEBI Compound Description  A benzoate ester obtained by the fromal condensation of the carboxy group of onosmin A with methanol. Isolated from Onosma hispida, it exhibits inhibitory activity against lipoxygenase.
ChEBI Compound Identification Number  66822
ChEBI InChI Value  InChI=1S/C16H17NO2/c1-12-7-9-13(10-8-12)11-17-15-6-4-3-5-14(15)16(18)19-2/h3-10,17H,11H2,1-2H3
ChEBI InChIKey Value  YBTJTIATNGZKEJ-UHFFFAOYSA-N
ChEBI Compound Name  onosmin B
ChEBI SMILES Value  COC(=O)c1ccccc1NCc1ccc(C)cc1
ChEBI Substance ID  160710410
ChEBI URL  ChEBI:66822
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  YBTJTIATNGZKEJ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  11334308