Item 15 of 2769 (back to results) previous next 7,8-dihydromethanopterin A member of the class of methanopterins resulting from the formal hydrogenation at the 7 and 8 positions of methanopterin.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > pnictogen molecular entity [CHEBI:33302] > phosphorus molecular entity [CHEBI:26082] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   phosphorus molecular entity [CHEBI:26082] (2769)   organophosphorus compound [CHEBI:25710] (1528)   organic phosphate [CHEBI:25703] (1511)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  phosphorus oxoacids and derivatives [CHEBI:36360] (2691)   phosphorus oxoacid derivative [CHEBI:36359] (2628)   phosphoric acid derivative [CHEBI:26079] (2611)   organic phosphate [CHEBI:25703] (1511)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  phosphate [CHEBI:26020] (1522)   organic phosphate [CHEBI:25703] (1511)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  phosphoric ester [CHEBI:37734] (1466)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organophosphorus compound [CHEBI:25710] (1528)   organic phosphate [CHEBI:25703] (1511)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  ester [CHEBI:35701] (3370)   phosphoric ester [CHEBI:37734] (1466)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   phosphorus oxoacid derivative [CHEBI:36359] (2628)   phosphoric acid derivative [CHEBI:26079] (2611)   organic phosphate [CHEBI:25703] (1511)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  phosphate [CHEBI:26020] (1522)   organic phosphate [CHEBI:25703] (1511)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1)  phosphoric ester [CHEBI:37734] (1466)   pterin phosphate [CHEBI:36942] (18)   methanopterins [CHEBI:37669] (10)   7,8-dihydromethanopterin [CHEBI:2251] (1) ChEBI Compound Accession Identifier:   [CHEBI:2251] ChEBI Compound Description:   A member of the class of methanopterins resulting from the formal hydrogenation at the 7 and 8 positions of methanopterin. ChEBI Compound Identification Number:   2251 ChEBI InChI Value:   InChI=1S/C30H43N6O16P/c1-12(21-13(2)33-26-22(34-21)27(44)36-30(31)35-26)32-15-5-3-14(4-6-15)9-16(37)23(41)17(38)10-49-29-25(43)24(42)19(51-29)11-50-53(47,48)52-18(28(45)46)7-8-20(39)40/h3-6,12-13,16-19,23-25,29,32,37-38,41-43H,7-11H2,1-2H3,(H,39,40)(H,45,46)(H,47,48)(H4,31,33,35,36,44)/t12-,13+,16+,17-,18+,19-,23+,24-,25-,29+/m1/s1 ChEBI InChIKey Value:   WTMBWYHMZCVPRJ-WJBIZLLUSA-N ChEBI Compound Name:   7,8-dihydromethanopterin ChEBI SMILES Value:   C[C@@H](Nc1ccc(C[C@H](O)[C@H](O)[C@H](O)CO[C@H]2O[C@H](COP(O)(=O)O[C@@H](CCC(O)=O)C(O)=O)[C@@H](O)[C@H]2O)cc1)C1=Nc2c(N[C@H]1C)nc(N)[nH]c2=O ChEBI Substance ID:   162012088 ChEBI URL:   ChEBI:2251 ChemSpider ID:   389685 Ontomatica Chemical Accession Key (OnChAKey):   WTMBWYHMZCVPRJ_WJBIZLLUSA_N_000_000000 PubChem Compound ID:   440843