| more general categories |
information about this item |
|
| 06. Name of Biological Source of Chemical |
 |
 |
|
06. Name of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Phellodendron amurense (1) |
|
 |
| 07. Part of Biological Source of Chemical |
 |
 |
|
07. Part of Biological Source of Chemical |
|
|
|
unspecified structure [PO:0000004] (703) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phellamurin [CHEBI:8048] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:8048] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
8048 |
| ChEBI InChI Value: |
InChI=1S/C26H30O11/c1-11(2)3-8-14-16(35-26-23(34)21(32)19(30)17(10-27)36-26)9-15(29)18-20(31)22(33)24(37-25(14)18)12-4-6-13(28)7-5-12/h3-7,9,17,19,21-24,26-30,32-34H,8,10H2,1-2H3/t17-,19-,21+,22+,23-,24-,26-/m1/s1 |
| ChEBI InChIKey Value: |
GRDZTDZJQRPNCN-YIANMRPHSA-N |
| ChEBI Compound Name: |
phellamurin |
| ChEBI SMILES Value: |
CC(C)=CCc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c2C(=O)[C@H](O)[C@H](Oc12)c1ccc(O)cc1 |
| ChEBI Substance ID: |
163725459 |
| ChEBI URL: |
ChEBI:8048 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
GRDZTDZJQRPNCN_YIANMRPHSA_N_000_000000 |
| PubChem Compound ID: |
193876 |