New Search

Item 15 of 22 (back to results)
Previous previous next Next

rocaglamide
An organic heterotricyclic compound that is 2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan substituted by hydroxy groups at positions 1 and 8b, methoxy groups at positions 6 and 8, a 4-methoxyphenyl group at position 3a, a phenyl group at position 3 and a N,N-dimethylcarbamoyl group at position 1. Isolated from Aglaia odorata and Aglaia duperreana, it exhibits antineoplastic activity.


Current search:

07. Part of Biological Source of Chemical: plant structure [PO:0009011]
×
03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 rocaglamide [CHEBI:66309] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antimicrobial drug [CHEBI:36043] (169) 
 antiprotozoal drug [CHEBI:35820] (168) 
 antileishmanial agent [CHEBI:70868] (22) 
 rocaglamide [CHEBI:66309] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 rocaglamide [CHEBI:66309] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Sapindales (202) 
 Meliaceae (118) 
 Aglaia (34) 
 Aglaia duperreana (1)
 Aglaia elliptifolia (2)
 Aglaia odorata (2)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 phyllome [PO:0006001] (351) 
 leaf [PO:0025034] (351)
 plant axis [PO:0025004] (691) 
 root [PO:0009005] (486)
 shoot axis [PO:0025029] (271) 
 stem [PO:0009047] (170)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 rocaglamide [CHEBI:66309] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 rocaglamide [CHEBI:66309] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 carboxamide [CHEBI:37622] (1381) 
 rocaglamide [CHEBI:66309] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 carboxamide [CHEBI:37622] (1381) 
 rocaglamide [CHEBI:66309] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 rocaglamide [CHEBI:66309] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 carboxamide [CHEBI:37622] (1381) 
 rocaglamide [CHEBI:66309] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 monomethoxybenzene [CHEBI:25235] (32) 
 rocaglamide [CHEBI:66309] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 rocaglamide [CHEBI:66309] (1)
ChEBI Compound Accession Identifier  [CHEBI:66309]
ChEBI Compound Description  An organic heterotricyclic compound that is 2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan substituted by hydroxy groups at positions 1 and 8b, methoxy groups at positions 6 and 8, a 4-methoxyphenyl group at position 3a, a phenyl group at position 3 and a N,N-dimethylcarbamoyl group at position 1. Isolated from Aglaia odorata and Aglaia duperreana, it exhibits antineoplastic activity.
ChEBI Compound Identification Number  66309
ChEBI InChI Value  InChI=1S/C29H31NO7/c1-30(2)27(32)23-24(17-9-7-6-8-10-17)29(18-11-13-19(34-3)14-12-18)28(33,26(23)31)25-21(36-5)15-20(35-4)16-22(25)37-29/h6-16,23-24,26,31,33H,1-5H3/t23-,24-,26-,28+,29+/m1/s1
ChEBI InChIKey Value  DAPAQENNNINUPW-IDAMAFBJSA-N
ChEBI Compound Name  rocaglamide
ChEBI SMILES Value  COc1ccc(cc1)[C@@]12Oc3cc(OC)cc(OC)c3[C@]1(O)[C@H](O)[C@@H]([C@H]2c1ccccc1)C(=O)N(C)C
ChEBI Substance ID  160709804
ChEBI URL  ChEBI:66309
ChemSpider ID  293974
Ontomatica Chemical Accession Key (OnChAKey)  DAPAQENNNINUPW_IDAMAFBJSA_N_000_000000
PubChem Compound ID  331783