New Search

Item 15 of 23 (back to results)
Previous previous next Next

bromophenol blue
3H-2,1-Benzoxathiole 1,1-dioxide in which both of the hydrogens at position 3 have been substituted by 3,5-dibromo-4-hydroxyphenyl groups. It is used as a laboratory indicator, changing from yellow below pH 3 to purple at pH 4.6, and as a size marker for monitoring the progress of agarose gel and polyacrylamide gel electrophoresis. It has also been used as an industrial dye.


Current search:

05. Industrial Uses: indicator [CHEBI:47867]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 indicator [CHEBI:47867] (23) 
 visual indicator [CHEBI:50408] (4) 
 colour indicator [CHEBI:50410] (4) 
 acid-base indicator [CHEBI:50407] (3) 
 bromophenol blue [CHEBI:59424] (1)
 two-colour indicator [CHEBI:50412] (3) 
 bromophenol blue [CHEBI:59424] (1)
 dye [CHEBI:37958] (446) 
 bromophenol blue [CHEBI:59424] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 bromine molecular entity [CHEBI:22928] (199) 
 organobromine compound [CHEBI:37141] (138) 
 bromophenol blue [CHEBI:59424] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bromophenol blue [CHEBI:59424] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 arenesulfonate ester [CHEBI:38094] (12) 
 bromophenol blue [CHEBI:59424] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bromophenol blue [CHEBI:59424] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 ester [CHEBI:35701] (3370) 
 sultone [CHEBI:38088] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzoxathiole [CHEBI:38086] (3) 
 2,1-benzoxathiole [CHEBI:38087] (2) 
 bromophenol blue [CHEBI:59424] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 bromophenol blue [CHEBI:59424] (1)
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 arenesulfonate ester [CHEBI:38094] (12) 
 bromophenol blue [CHEBI:59424] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bromophenol blue [CHEBI:59424] (1)
ChEBI Compound Accession Identifier  [CHEBI:59424]
ChEBI Compound Description  3H-2,1-Benzoxathiole 1,1-dioxide in which both of the hydrogens at position 3 have been substituted by 3,5-dibromo-4-hydroxyphenyl groups. It is used as a laboratory indicator, changing from yellow below pH 3 to purple at pH 4.6, and as a size marker for monitoring the progress of agarose gel and polyacrylamide gel electrophoresis. It has also been used as an industrial dye.
ChEBI Compound Identification Number  59424
ChEBI InChI Value  InChI=1S/C19H10Br4O5S/c20-12-5-9(6-13(21)17(12)24)19(10-7-14(22)18(25)15(23)8-10)11-3-1-2-4-16(11)29(26,27)28-19/h1-8,24-25H
ChEBI InChIKey Value  UDSAIICHUKSCKT-UHFFFAOYSA-N
ChEBI Compound Name  bromophenol blue
ChEBI SMILES Value  Oc1c(Br)cc(cc1Br)C1(OS(=O)(=O)c2ccccc12)c1cc(Br)c(O)c(Br)c1
ChEBI Substance ID  93581483
ChEBI URL  ChEBI:59424
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  UDSAIICHUKSCKT_UHFFFAOYSA_N_000_000000
PubChem Compound ID  8272