Item 147 of 244 (back to results) previous next fukanefuromarin G A furanocoumarin that is 2,3-dihydrofuro[3,2-c]coumarin substituted by methoxy group at position 7, methyl group at positions 2 and 3 (relatively trans configuration) and a 4-methyl-5-(4-methyl-2-furyl)-3(E)-pentenyl moiety at position 2. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).

Current search: 07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] > plant organ [PO:0009008] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   nitric oxide synthase inhibitor [CHEBI:61908] (36)   fukanefuromarin G [CHEBI:65927] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   fukanefuromarin G [CHEBI:65927] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Apiales (90)   Apiaceae (42)   Ferula (25)   Ferula fukanensis (12) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   fukanefuromarin G [CHEBI:65927] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   sesquiterpenoid [CHEBI:26658] (209)   fukanefuromarin G [CHEBI:65927] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  oxacycle [CHEBI:38104] (2002)   furans [CHEBI:24129] (114)   fukanefuromarin G [CHEBI:65927] (1)  furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   fukanefuromarin G [CHEBI:65927] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   furochromene [CHEBI:39432] (37)   furanocoumarin [CHEBI:24128] (35)   fukanefuromarin G [CHEBI:65927] (1) ChEBI Compound Accession Identifier:   [CHEBI:65927] ChEBI Compound Description:   A furanocoumarin that is 2,3-dihydrofuro[3,2-c]coumarin substituted by methoxy group at position 7, methyl group at positions 2 and 3 (relatively trans configuration) and a 4-methyl-5-(4-methyl-2-furyl)-3(E)-pentenyl moiety at position 2. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO). ChEBI Compound Identification Number:   65927 ChEBI InChI Value:   InChI=1S/C25H28O5/c1-15(11-19-12-16(2)14-28-19)7-6-10-25(4)17(3)22-23(30-25)20-9-8-18(27-5)13-21(20)29-24(22)26/h7-9,12-14,17H,6,10-11H2,1-5H3/b15-7+/t17-,25-/m1/s1 ChEBI InChIKey Value:   GKKFSJKWTPVFGM-JRLFELCZSA-N ChEBI Compound Name:   fukanefuromarin G ChEBI SMILES Value:   COc1ccc2c3O[C@](C)(CC\C=C(/C)Cc4cc(C)co4)[C@H](C)c3c(=O)oc2c1 ChEBI Substance ID:   160709569 ChEBI URL:   ChEBI:65927 ChemSpider ID:   8584614 Ontomatica Chemical Accession Key (OnChAKey):   GKKFSJKWTPVFGM_JRLFELCZSA_N_000_000000 PubChem Compound ID:   10409177