New Search

Item 147 of 244 (back to results)
Previous previous next Next

fukanefuromarin G
A furanocoumarin that is 2,3-dihydrofuro[3,2-c]coumarin substituted by methoxy group at position 7, methyl group at positions 2 and 3 (relatively trans configuration) and a 4-methyl-5-(4-methyl-2-furyl)-3(E)-pentenyl moiety at position 2. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).


Current search:

07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] > plant organ [PO:0009008]
×
03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 nitric oxide synthase inhibitor [CHEBI:61908] (36) 
 fukanefuromarin G [CHEBI:65927] (1)
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 fukanefuromarin G [CHEBI:65927] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Apiales (90) 
 Apiaceae (42) 
 Ferula (25) 
 Ferula fukanensis (12)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 plant axis [PO:0025004] (691) 
 root [PO:0009005] (486)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 sesquiterpenoid [CHEBI:26658] (209) 
 fukanefuromarin G [CHEBI:65927] (1)
 isoprenoid [CHEBI:24913] (1402) 
 terpenoid [CHEBI:26873] (1099) 
 sesquiterpenoid [CHEBI:26658] (209) 
 fukanefuromarin G [CHEBI:65927] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 oxacycle [CHEBI:38104] (2002) 
 furans [CHEBI:24129] (114) 
 fukanefuromarin G [CHEBI:65927] (1)
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic ether [CHEBI:35618] (353) 
 fukanefuromarin G [CHEBI:65927] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 furochromene [CHEBI:39432] (37) 
 furanocoumarin [CHEBI:24128] (35) 
 fukanefuromarin G [CHEBI:65927] (1)
ChEBI Compound Accession Identifier  [CHEBI:65927]
ChEBI Compound Description  A furanocoumarin that is 2,3-dihydrofuro[3,2-c]coumarin substituted by methoxy group at position 7, methyl group at positions 2 and 3 (relatively trans configuration) and a 4-methyl-5-(4-methyl-2-furyl)-3(E)-pentenyl moiety at position 2. Isolated from the roots of Ferula fukanensis, it inhibits production of nitric oxide (NO).
ChEBI Compound Identification Number  65927
ChEBI InChI Value  InChI=1S/C25H28O5/c1-15(11-19-12-16(2)14-28-19)7-6-10-25(4)17(3)22-23(30-25)20-9-8-18(27-5)13-21(20)29-24(22)26/h7-9,12-14,17H,6,10-11H2,1-5H3/b15-7+/t17-,25-/m1/s1
ChEBI InChIKey Value  GKKFSJKWTPVFGM-JRLFELCZSA-N
ChEBI Compound Name  fukanefuromarin G
ChEBI SMILES Value  COc1ccc2c3O[C@](C)(CC\C=C(/C)Cc4cc(C)co4)[C@H](C)c3c(=O)oc2c1
ChEBI Substance ID  160709569
ChEBI URL  ChEBI:65927
ChemSpider ID  8584614
Ontomatica Chemical Accession Key (OnChAKey)  GKKFSJKWTPVFGM_JRLFELCZSA_N_000_000000
PubChem Compound ID  10409177