New Search

Item 16 of 126 (back to results)
Previous previous next Next

cefpodoxime
A third-generation cephalosporin antibiotic with methoxymethyl and (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamino substituents at positions 3 and 7, respectively, of the cephem skeleton. Given by mouth as its proxetil ester prodrug, it is used to treat acute otitis media, pharyngitis, and sinusitis.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antibacterial agent [CHEBI:33282] (317) 
 antibacterial drug [CHEBI:36047] (177) 
 cefpodoxime [CHEBI:3504] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 cyclic amide [CHEBI:3990] (252) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heterocyclic antibiotic [CHEBI:24531] (153) 
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 lactam [CHEBI:24995] (252) 
 beta-lactam [CHEBI:35627] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organonitrogen heterocyclic antibiotic [CHEBI:25558] (144) 
 beta-lactam antibiotic [CHEBI:27933] (140) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 cephem [CHEBI:38311] (43) 
 cephalosporin [CHEBI:23066] (42) 
 cefpodoxime [CHEBI:3504] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 cefpodoxime [CHEBI:3504] (1)
ChEBI Compound Accession Identifier  [CHEBI:3504]
ChEBI Compound Description  A third-generation cephalosporin antibiotic with methoxymethyl and (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamino substituents at positions 3 and 7, respectively, of the cephem skeleton. Given by mouth as its proxetil ester prodrug, it is used to treat acute otitis media, pharyngitis, and sinusitis.
ChEBI Compound Identification Number  3504
ChEBI InChI Value  InChI=1S/C15H17N5O6S2/c1-25-3-6-4-27-13-9(12(22)20(13)10(6)14(23)24)18-11(21)8(19-26-2)7-5-28-15(16)17-7/h5,9,13H,3-4H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/b19-8-/t9-,13-/m1/s1
ChEBI InChIKey Value  WYUSVOMTXWRGEK-HBWVYFAYSA-N
ChEBI Compound Name  cefpodoxime
ChEBI SMILES Value  [H][C@]12SCC(COC)=C(N1C(=O)[C@H]2NC(=O)C(=N/OC)\\c1csc(N)n1)C(O)=O
ChEBI Substance ID  96099266
ChEBI URL  ChEBI:3504
ChemSpider ID  4891496
Ontomatica Chemical Accession Key (OnChAKey)  WYUSVOMTXWRGEK_HBWVYFAYSA_N_000_000000
PubChem Compound ID  6335986