New Search

Item 16 of 18 (back to results)
Previous previous next Next

U69593
A carboxamide obtained by formal condensation between the carboxy group of phenylacetic acid and the secodary amino group of (5R,7S,8S)-N-methyl-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]decan-8-amine.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > opioid agent [CHEBI:60598]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 opioid agent [CHEBI:60598] (32) 
 kappa-opioid agent [CHEBI:60603] (6) 
 kappa-opioid receptor agonist [CHEBI:59282] (6) 
 U69593 [CHEBI:73357] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 diuretic [CHEBI:35498] (18) 
 U69593 [CHEBI:73357] (1)
 anti-inflammatory agent [CHEBI:67079] (79) 
 U69593 [CHEBI:73357] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 U69593 [CHEBI:73357] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 U69593 [CHEBI:73357] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 U69593 [CHEBI:73357] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 U69593 [CHEBI:73357] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 spiro compound [CHEBI:33599] (78) 
 oxaspiro compound [CHEBI:37948] (63) 
 U69593 [CHEBI:73357] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyrrolidines [CHEBI:38260] (159) 
 N-alkylpyrrolidine [CHEBI:46775] (24) 
 U69593 [CHEBI:73357] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 U69593 [CHEBI:73357] (1)
ChEBI Compound Accession Identifier  [CHEBI:73357]
ChEBI Compound Description  A carboxamide obtained by formal condensation between the carboxy group of phenylacetic acid and the secodary amino group of (5R,7S,8S)-N-methyl-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]decan-8-amine.
ChEBI Compound Identification Number  73357
ChEBI InChI Value  InChI=1S/C22H32N2O2/c1-23(21(25)16-18-8-3-2-4-9-18)19-10-12-22(11-7-15-26-22)17-20(19)24-13-5-6-14-24/h2-4,8-9,19-20H,5-7,10-17H2,1H3/t19-,20-,22-/m0/s1
ChEBI InChIKey Value  PGZRDDYTKFZSFR-ONTIZHBOSA-N
ChEBI Compound Name  U69593
ChEBI SMILES Value  CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1)C(=O)Cc1ccccc1
ChEBI Substance ID  163426066
ChEBI URL  ChEBI:73357
ChemSpider ID  94828
Ontomatica Chemical Accession Key (OnChAKey)  PGZRDDYTKFZSFR_ONTIZHBOSA_N_000_000000
PubChem Compound ID  105104