New Search

Item 16 of 52 (back to results)
Previous previous next Next

spiperone
An azaspiro compound that is 1,3,8-triazaspiro[4.5]decane which is substituted at positions 1, 4, and 8 by phenyl, oxo, and 4-(p-fluorophenyl)-4-oxobutyl groups, respectively.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > serotonergic drug [CHEBI:48278] > serotonergic antagonist [CHEBI:48279]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 adrenergic agent [CHEBI:37962] (143) 
 adrenergic antagonist [CHEBI:37887] (75) 
 alpha-adrenergic antagonist [CHEBI:37890] (28) 
 spiperone [CHEBI:9233] (1)
 serotonergic drug [CHEBI:48278] (109) 
 serotonergic antagonist [CHEBI:48279] (52) 
 spiperone [CHEBI:9233] (1)
 dopaminergic agent [CHEBI:48560] (99) 
 dopaminergic antagonist [CHEBI:48561] (48) 
 spiperone [CHEBI:9233] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 spiperone [CHEBI:9233] (1)
 tranquilizing drug [CHEBI:35473] (83) 
 antipsychotic agent [CHEBI:35476] (51) 
 spiperone [CHEBI:9233] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 fluorine molecular entity [CHEBI:24062] (288) 
 organofluorine compound [CHEBI:37143] (275) 
 spiperone [CHEBI:9233] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 spiperone [CHEBI:9233] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 spiperone [CHEBI:9233] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 spiperone [CHEBI:9233] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 spiperone [CHEBI:9233] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 spiperone [CHEBI:9233] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 spiperone [CHEBI:9233] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 spiperone [CHEBI:9233] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 spiperone [CHEBI:9233] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 spiperone [CHEBI:9233] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 spiro compound [CHEBI:33599] (78) 
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 spiperone [CHEBI:9233] (1)
 azaspiro compound [CHEBI:35624] (22) 
 spiperone [CHEBI:9233] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 spiperone [CHEBI:9233] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 spiperone [CHEBI:9233] (1)
ChEBI Compound Accession Identifier  [CHEBI:9233]
ChEBI Compound Description  An azaspiro compound that is 1,3,8-triazaspiro[4.5]decane which is substituted at positions 1, 4, and 8 by phenyl, oxo, and 4-(p-fluorophenyl)-4-oxobutyl groups, respectively.
ChEBI Compound Identification Number  9233
ChEBI InChI Value  InChI=1S/C23H26FN3O2/c24-19-10-8-18(9-11-19)21(28)7-4-14-26-15-12-23(13-16-26)22(29)25-17-27(23)20-5-2-1-3-6-20/h1-3,5-6,8-11H,4,7,12-17H2,(H,25,29)
ChEBI InChIKey Value  DKGZKTPJOSAWFA-UHFFFAOYSA-N
ChEBI Compound Name  spiperone
ChEBI SMILES Value  Fc1ccc(cc1)C(=O)CCCN1CCC2(CC1)N(CNC2=O)c1ccccc1
ChEBI Substance ID  49658630
ChEBI URL  ChEBI:9233
ChemSpider ID  5075
Ontomatica Chemical Accession Key (OnChAKey)  DKGZKTPJOSAWFA_UHFFFAOYSA_N_000_000000
PubChem Compound ID  5265