Item 16 of 21 (back to results) previous next pyrabactin A sulfonamide obtained by formal condensation of the sulfo group of 4-bromonaphthalene-1-sulfonic acid with the exocyclic amino group of 2-pyridylmethylamine. Mimics the action of the abscisic acid, a phytohormone.

Current search: 03. Biological Effects of Specific Chemicals: growth regulator [CHEBI:39317] > plant growth regulator [CHEBI:26155] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   agonist [CHEBI:48705] (68)   abscisic acid receptor agonist [CHEBI:73191] (2)   pyrabactin [CHEBI:73159] (1)  molecular messenger [CHEBI:33280] (92)   hormone [CHEBI:24621] (55)   pyrabactin [CHEBI:73159] (1)  growth regulator [CHEBI:39317] (34)   plant growth regulator [CHEBI:26155] (21)   pyrabactin [CHEBI:73159] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   pyrabactin [CHEBI:73159] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   pyrabactin [CHEBI:73159] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   sulfonamide [CHEBI:35358] (106)   pyrabactin [CHEBI:73159] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   pyrabactin [CHEBI:73159] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   pyrabactin [CHEBI:73159] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  bicyclic compound [CHEBI:33636] (1511)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyrabactin [CHEBI:73159] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   pyrabactin [CHEBI:73159] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   pyrabactin [CHEBI:73159] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   pyrabactin [CHEBI:73159] (1) ChEBI Compound Accession Identifier:   [CHEBI:73159] ChEBI Compound Description:   A sulfonamide obtained by formal condensation of the sulfo group of 4-bromonaphthalene-1-sulfonic acid with the exocyclic amino group of 2-pyridylmethylamine. Mimics the action of the abscisic acid, a phytohormone. ChEBI Compound Identification Number:   73159 ChEBI InChI Value:   InChI=1S/C16H13BrN2O2S/c17-15-8-9-16(14-7-2-1-6-13(14)15)22(20,21)19-11-12-5-3-4-10-18-12/h1-10,19H,11H2 ChEBI InChIKey Value:   GJSDYQXOSHKOGX-UHFFFAOYSA-N ChEBI Compound Name:   pyrabactin ChEBI SMILES Value:   Brc1ccc(c2ccccc12)S(=O)(=O)NCc1ccccn1 ChEBI Substance ID:   162169329 ChEBI URL:   ChEBI:73159 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   GJSDYQXOSHKOGX_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   1125790