New Search

Item 1505 of 1978 (back to results)
Previous previous next Next

juglanin B
A cyclic ketone isolated from the extract of the seed husks of walnuts Juglans regia and has been shown to exhibit cytotoxic activity against human hepatoma cells.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 juglanin B [CHEBI:66127] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 juglanin B [CHEBI:66127] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Fagales (25) 
 Juglandaceae (25) 
 Juglans (25) 
 Juglans regia (4)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 portion of plant tissue [PO:0009007] (272) 
 pericarp [PO:0009084] (3)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 juglanin B [CHEBI:66127] (1)
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 juglanin B [CHEBI:66127] (1)
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 juglanin B [CHEBI:66127] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 juglanin B [CHEBI:66127] (1)
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 juglanin B [CHEBI:66127] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 juglanin B [CHEBI:66127] (1)
 phenols [CHEBI:33853] (868) 
 juglanin B [CHEBI:66127] (1)
ChEBI Compound Accession Identifier  [CHEBI:66127]
ChEBI Compound Description  A cyclic ketone isolated from the extract of the seed husks of walnuts Juglans regia and has been shown to exhibit cytotoxic activity against human hepatoma cells.
ChEBI Compound Identification Number  66127
ChEBI InChI Value  InChI=1S/C20H24O4/c1-24-19-12-14-4-2-3-5-15(21)8-6-13-7-9-18(22)16(10-13)17(11-14)20(19)23/h7,9-12,15,21-23H,2-6,8H2,1H3/t15-/m0/s1
ChEBI InChIKey Value  AVDQDLSGSIPLPN-HNNXBMFYSA-N
ChEBI Compound Name  juglanin B
ChEBI SMILES Value  COc1cc2CCCC[C@H](O)CCc3ccc(O)c(c3)-c(c2)c1O
ChEBI Substance ID  160710207
ChEBI URL  ChEBI:66127
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  AVDQDLSGSIPLPN_HNNXBMFYSA_N_000_000000
PubChem Compound ID  44155973