Item 153 of 244 (back to results) previous next glycyrrhizol B An organic heteropentacyclic compound that is 2H-pyrano[3',4',5'',6'']-pterocarpene substituted by a hydroxy group at position 7, a methoxy group at position 5 and geminal methyl groups at position 2''. Isolated from the roots of Glycyrrhiza uralensis, it exhibits antibacterial activity.

Current search: 07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496] > plant organ [PO:0009008] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   glycyrrhizol B [CHEBI:65977] (1)  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   glycyrrhizol B [CHEBI:65977] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Fabales (151)   Fabaceae (151)   Faboideae (97)   Glycyrrhiza (26)   Glycyrrhiza uralensis (24) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   glycyrrhizol B [CHEBI:65977] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   glycyrrhizol B [CHEBI:65977] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   glycyrrhizol B [CHEBI:65977] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   glycyrrhizol B [CHEBI:65977] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   glycyrrhizol B [CHEBI:65977] (1) ChEBI Compound Accession Identifier:   [CHEBI:65977] ChEBI Compound Description:   An organic heteropentacyclic compound that is 2H-pyrano[3',4',5'',6'']-pterocarpene substituted by a hydroxy group at position 7, a methoxy group at position 5 and geminal methyl groups at position 2''. Isolated from the roots of Glycyrrhiza uralensis, it exhibits antibacterial activity. ChEBI Compound Identification Number:   65977 ChEBI InChI Value:   InChI=1S/C21H18O5/c1-21(2)7-6-13-15(26-21)5-4-12-14-10-24-17-9-11(22)8-16(23-3)18(17)20(14)25-19(12)13/h4-9,22H,10H2,1-3H3 ChEBI InChIKey Value:   BKLGAGSBCOUJGV-UHFFFAOYSA-N ChEBI Compound Name:   glycyrrhizol B ChEBI SMILES Value:   COc1cc(O)cc2OCc3c(oc4c5C=CC(C)(C)Oc5ccc34)-c12 ChEBI Substance ID:   160709832 ChEBI URL:   ChEBI:65977 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   BKLGAGSBCOUJGV_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   11609971