New Search

Item 155 of 267 (back to results)
Previous previous next Next

flavokawain B
A member of the class of chalcones that consists of trans-chalcone substituted by hydroxy group at positions 2' and methoxy groups at positions 4' and 6'. Isolated from Piper methysticum and Piper rusbyi, it exhibits antileishmanial, anti-inflammatory and antineoplastic activities.


Current search:

07. Part of Biological Source of Chemical: plant structure [PO:0009011] > multi-tissue plant structure [PO:0025496]
×
03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 apoptosis inducer [CHEBI:68495] (23) 
 flavokawain B [CHEBI:65899] (1)
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 flavokawain B [CHEBI:65899] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antimicrobial drug [CHEBI:36043] (169) 
 antiprotozoal drug [CHEBI:35820] (168) 
 antileishmanial agent [CHEBI:70868] (22) 
 flavokawain B [CHEBI:65899] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 flavokawain B [CHEBI:65899] (1)
 anti-inflammatory agent [CHEBI:67079] (79) 
 flavokawain B [CHEBI:65899] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Piperales (63) 
 Piperaceae (62) 
 Piper (62) 
 Piper methysticum (1)
 Piper rusbyi (2)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
 plant structure [PO:0009011] (1497) 
 multi-tissue plant structure [PO:0025496] (1114) 
 plant organ [PO:0009008] (970) 
 phyllome [PO:0006001] (351) 
 leaf [PO:0025034] (351)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 flavonoids [CHEBI:72544] (433) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 flavonoids [CHEBI:72544] (433) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 flavokawain B [CHEBI:65899] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 chalcones [CHEBI:23086] (25) 
 flavokawain B [CHEBI:65899] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 flavokawain B [CHEBI:65899] (1)
ChEBI Compound Accession Identifier  [CHEBI:65899]
ChEBI Compound Description  A member of the class of chalcones that consists of trans-chalcone substituted by hydroxy group at positions 2' and methoxy groups at positions 4' and 6'. Isolated from Piper methysticum and Piper rusbyi, it exhibits antileishmanial, anti-inflammatory and antineoplastic activities.
ChEBI Compound Identification Number  65899
ChEBI InChI Value  InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+
ChEBI InChIKey Value  QKQLSQLKXBHUSO-CMDGGOBGSA-N
ChEBI Compound Name  flavokawain B
ChEBI SMILES Value  COc1cc(O)c(C(=O)\C=C\c2ccccc2)c(OC)c1
ChEBI Substance ID  160709584
ChEBI URL  ChEBI:65899
ChemSpider ID  4511912
Ontomatica Chemical Accession Key (OnChAKey)  QKQLSQLKXBHUSO_CMDGGOBGSA_N_000_000000
PubChem Compound ID  5356121