Select any link to see items in a related category.
more general categories information about this item 03. Biological Effects of Specific Chemicals 03. Biological Effects of Specific Chemicals biochemical uses [CHEBI:52206] (3306) metabolite [CHEBI:25212] (2692) secondary metabolite [CHEBI:26619] (2225) kynurenine [CHEBI:28683] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) p-block molecular entity [CHEBI:33675] (25343) pnictogen molecular entity [CHEBI:33302] (10027) nitrogen molecular entity [CHEBI:51143] (7930) organonitrogen compound [CHEBI:35352] (6705) organic amino compound [CHEBI:50047] (2472) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) carbonyl compound [CHEBI:36586] (5928) ketone [CHEBI:17087] (1288) kynurenine [CHEBI:28683] (2) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) carbonyl compound [CHEBI:36586] (5928) ketone [CHEBI:17087] (1288) kynurenine [CHEBI:28683] (2) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organonitrogen compound [CHEBI:35352] (6705) organic amino compound [CHEBI:50047] (2472) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) carbonyl compound [CHEBI:36586] (5928) ketone [CHEBI:17087] (1288) kynurenine [CHEBI:28683] (2) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) organic amino compound [CHEBI:50047] (2472) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) ketone [CHEBI:17087] (1288) kynurenine [CHEBI:28683] (2) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) cyclic compound [CHEBI:33595] (7817) homocyclic compound [CHEBI:33597] (1134) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) aromatic compound [CHEBI:33655] (3799) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) carbocyclic compound [CHEBI:33598] (1130) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic aromatic compound [CHEBI:33659] (3593) benzenoid aromatic compound [CHEBI:33836] (730) benzenes [CHEBI:22712] (386) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) aromatic amine [CHEBI:33860] (91) anilines [CHEBI:22562] (73) substituted aniline [CHEBI:48975] (61) kynurenine [CHEBI:28683] (2) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) ketone [CHEBI:17087] (1288) kynurenine [CHEBI:28683] (2) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) amino acid [CHEBI:33709] (959) modified amino acid [CHEBI:25359] (654) alanine derivative [CHEBI:22278] (40) kynurenine [CHEBI:28683] (2) ChEBI Compound Accession Identifier: [CHEBI:28683] ChEBI Compound Description: A ketone that is alanine in which one of the methyl hydrogens is substituted by a 2-aminobenzoyl group. ChEBI Compound Identification Number: 28683 ChEBI InChI Value: InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15) ChEBI InChIKey Value: YGPSJZOEDVAXAB-UHFFFAOYSA-N ChEBI Compound Name: kynurenine ChEBI SMILES Value: NC(CC(=O)c1ccccc1N)C(O)=O ChEBI Substance ID: 14717663 ChEBI URL: ChEBI:28683 ChemSpider ID: NS Ontomatica Chemical Accession Key (OnChAKey): YGPSJZOEDVAXAB_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 846
