Item 18 of 356 (back to results) previous next cerivastatin (3R,5S)-3,5-dihydroxyhept-6-enoic acid in which the (7E)-hydrogen is substituted by a 4-(4-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)pyridin-3-yl group. Formerly used (as its sodium salt) to lower cholesterol and prevent cardiovascular disease, it was withdrawn from the market worldwide in 2001 following reports of a severe form of muscle toxicity.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > molecule [CHEBI:25367] > cyclic compound [CHEBI:33595] > heterocyclic compound [CHEBI:5686] > heteromonocyclic compound [CHEBI:33670] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   hydroxymethylglutaryl-CoA reductase inhibitor [CHEBI:35664] (10)   cerivastatin [CHEBI:3558] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antilipemic drug [CHEBI:35679] (30)   cerivastatin [CHEBI:3558] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   cerivastatin [CHEBI:3558] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   dihydroxy monocarboxylic acid [CHEBI:35972] (45)   cerivastatin [CHEBI:3558] (1) ChEBI Compound Accession Identifier:   [CHEBI:3558] ChEBI Compound Description:   (3R,5S)-3,5-dihydroxyhept-6-enoic acid in which the (7E)-hydrogen is substituted by a 4-(4-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)pyridin-3-yl group. Formerly used (as its sodium salt) to lower cholesterol and prevent cardiovascular disease, it was withdrawn from the market worldwide in 2001 following reports of a severe form of muscle toxicity. ChEBI Compound Identification Number:   3558 ChEBI InChI Value:   InChI=1S/C26H34FNO5/c1-15(2)25-21(11-10-19(29)12-20(30)13-23(31)32)24(17-6-8-18(27)9-7-17)22(14-33-5)26(28-25)16(3)4/h6-11,15-16,19-20,29-30H,12-14H2,1-5H3,(H,31,32)/b11-10+/t19-,20-/m1/s1 ChEBI InChIKey Value:   SEERZIQQUAZTOL-ANMDKAQQSA-N ChEBI Compound Name:   cerivastatin ChEBI SMILES Value:   COCc1c(nc(C(C)C)c(\C=C\[C@@H](O)C[C@@H](O)CC(O)=O)c1-c1ccc(F)cc1)C(C)C ChEBI Substance ID:   93578306 ChEBI URL:   ChEBI:3558 ChemSpider ID:   393588 Ontomatica Chemical Accession Key (OnChAKey):   SEERZIQQUAZTOL_ANMDKAQQSA_N_000_000000 PubChem Compound ID:   446156