Item 18 of 36 (back to results) previous next 5-bromo-8-methoxy-1-methyl-beta-carboline A member of the class of beta-carboline that is 9H-beta-carboline substituted by bromo, methoxy and a methyl group at positions 5, 8 and 1 respectively. It is isolated from a marine bryozoan Pterocella vesiculosa and has been found to exhibit moderate antitumour activity against the P388 murine leukemia cell line. Additionally it shows antimicrobial activity towards the Gram-positive bacterium Bacillus subtilis and the fungi Candida albicans and Trichophyton mentagrophytes.

Current search: 08. Chemical Category: polyatomic entity [CHEBI:36357] > heteroatomic molecular entity [CHEBI:37577] > halide [CHEBI:37578] × 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  antifungal agent [CHEBI:35718] (130)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   pyridoindole [CHEBI:48888] (17)   beta-carbolines [CHEBI:60834] (16)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   5-bromo-8-methoxy-1-methyl-beta-carboline [CHEBI:65524] (1) ChEBI Compound Accession Identifier:   [CHEBI:65524] ChEBI Compound Description:   A member of the class of beta-carboline that is 9H-beta-carboline substituted by bromo, methoxy and a methyl group at positions 5, 8 and 1 respectively. It is isolated from a marine bryozoan Pterocella vesiculosa and has been found to exhibit moderate antitumour activity against the P388 murine leukemia cell line. Additionally it shows antimicrobial activity towards the Gram-positive bacterium Bacillus subtilis and the fungi Candida albicans and Trichophyton mentagrophytes. ChEBI Compound Identification Number:   65524 ChEBI InChI Value:   InChI=1S/C13H11BrN2O/c1-7-12-8(5-6-15-7)11-9(14)3-4-10(17-2)13(11)16-12/h3-6,16H,1-2H3 ChEBI InChIKey Value:   OVNRKQHNHZRXHF-UHFFFAOYSA-N ChEBI Compound Name:   5-bromo-8-methoxy-1-methyl-beta-carboline ChEBI SMILES Value:   COc1ccc(Br)c2c3ccnc(C)c3[nH]c12 ChEBI Substance ID:   160655732 ChEBI URL:   ChEBI:65524 ChemSpider ID:   24614357 Ontomatica Chemical Accession Key (OnChAKey):   OVNRKQHNHZRXHF_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   42638980