Item 18 of 24 (back to results) previous next bicozamycin A commercially important azabicyclic antibiotic obtained from Streptomyces sapporonensis. It inhibits the Rho protein of E. coli.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > gastrointestinal drug [CHEBI:55324] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   bicozamycin [CHEBI:60584] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antiinfective agent [CHEBI:35441] (82)   bicozamycin [CHEBI:60584] (1)  gastrointestinal drug [CHEBI:55324] (24)   antidiarrhoeal drug [CHEBI:55323] (7)   bicozamycin [CHEBI:60584] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  bridged compound [CHEBI:35990] (118)   bicozamycin [CHEBI:60584] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   azabicycloalkane [CHEBI:38295] (38)   bicozamycin [CHEBI:60584] (1) ChEBI Compound Accession Identifier:   [CHEBI:60584] ChEBI Compound Description:   A commercially important azabicyclic antibiotic obtained from Streptomyces sapporonensis. It inhibits the Rho protein of E. coli. ChEBI Compound Identification Number:   60584 ChEBI InChI Value:   InChI=1S/C12H18N2O7/c1-6-3-4-21-12(7(16)10(2,19)5-15)9(18)13-11(6,20)8(17)14-12/h7,15-16,19-20H,1,3-5H2,2H3,(H,13,18)(H,14,17)/t7-,10-,11+,12-/m0/s1 ChEBI InChIKey Value:   WOUDXEYYJPOSNE-VKZDFBPFSA-N ChEBI Compound Name:   bicozamycin ChEBI SMILES Value:   C[C@](O)(CO)[C@H](O)[C@@]12NC(=O)[C@@](O)(NC1=O)C(=C)CCO2 ChEBI Substance ID:   103158218 ChEBI URL:   ChEBI:60584 ChemSpider ID:   59222 Ontomatica Chemical Accession Key (OnChAKey):   WOUDXEYYJPOSNE_VKZDFBPFSA_N_000_000000 PubChem Compound ID:   65807