Item 172 of 177 (back to results) previous next cefazolin A cephalosporin compound having [(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl and (1H-tetrazol-1-ylacetyl)amino side groups.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antibacterial agent [CHEBI:33282] > antibacterial drug [CHEBI:36047] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   antibacterial drug [CHEBI:36047] (177)   cefazolin [CHEBI:474053] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   cyclic amide [CHEBI:3990] (252)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefazolin [CHEBI:474053] (1) ChEBI Compound Accession Identifier:   [CHEBI:474053] ChEBI Compound Description:   A cephalosporin compound having [(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl and (1H-tetrazol-1-ylacetyl)amino side groups. ChEBI Compound Identification Number:   474053 ChEBI InChI Value:   InChI=1S/C14H14N8O4S3/c1-6-17-18-14(29-6)28-4-7-3-27-12-9(11(24)22(12)10(7)13(25)26)16-8(23)2-21-5-15-19-20-21/h5,9,12H,2-4H2,1H3,(H,16,23)(H,25,26)/t9-,12-/m1/s1 ChEBI InChIKey Value:   MLYYVTUWGNIJIB-BXKDBHETSA-N ChEBI Compound Name:   cefazolin ChEBI SMILES Value:   [H][C@]12SCC(CSc3nnc(C)s3)=C(N1C(=O)[C@H]2NC(=O)Cn1cnnn1)C(O)=O ChEBI Substance ID:   85663279 ChEBI URL:   ChEBI:474053 ChemSpider ID:   30723 Ontomatica Chemical Accession Key (OnChAKey):   MLYYVTUWGNIJIB_BXKDBHETSA_N_000_000000 PubChem Compound ID:   33255