| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
BML-210 [CHEBI:61077] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:61077] |
| ChEBI Compound Description: |
A dicarboxylic acid diamide comprising suberic (octanedioic) acid coupled to aniline and 1,2-diaminobenzene. |
| ChEBI Compound Identification Number: |
61077 |
| ChEBI InChI Value: |
InChI=1S/C20H25N3O2/c21-17-12-8-9-13-18(17)23-20(25)15-7-2-1-6-14-19(24)22-16-10-4-3-5-11-16/h3-5,8-13H,1-2,6-7,14-15,21H2,(H,22,24)(H,23,25) |
| ChEBI InChIKey Value: |
RFLHBLWLFUFFDZ-UHFFFAOYSA-N |
| ChEBI Compound Name: |
BML-210 |
| ChEBI SMILES Value: |
Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1ccccc1 |
| ChEBI Substance ID: |
104222361 |
| ChEBI URL: |
ChEBI:61077 |
| ChemSpider ID: |
7822491 |
| Ontomatica Chemical Accession Key (OnChAKey): |
RFLHBLWLFUFFDZ_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
9543540 |